Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-FC-0084 |
Product Name | Xylitol |
CAS | 87-99-0 |
Structure | ![]() |
Synonyms | (2S,4R)-pentane-1,2,3,4,5-pentol |
IUPAC Name | (2S,4R)-pentane-1,2,3,4,5-pentol |
Molecular Weight | 152.15 g/mol |
Molecular Formula | C5H12O5 |
InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
InChI Key | HEBKCHPVOIAQTA-NGQZWQHPSA-N |
Boiling Point | 215-217 °C |
Melting Point | 94-97 °C |
Purity | 0.98 |
Density | 1.52 g/mL |
Appearance | White powder |
Isomeric SMILES | C([C@H](C([C@H](CO)O)O)O)O |
What is Xylitol and where does it come from?
Xylitol is a sugar alcohol that can be either plant-derived or synthetically produced. It naturally occurs in various fruits and vegetables, such as mushrooms, lettuce, oats, strawberries, bananas, and yellow plums. It can also be derived from wood or upcycled paper.
What are the benefits of Xylitol for the skin?
Xylitol is known for its excellent hydration properties due to its ability to attract and bind moisture, acting as a humectant. This quality helps in soothing the skin without a greasy feel. Additionally, it aids in normalizing skin processes by supporting the health of keratinocytes, or skin cells, which enhances the skin's natural functioning and resilience.
Is Xylitol safe for use in cosmetics and skincare products?
Yes, xylitol is considered safe for use in cosmetics. In the United States, it is also approved for use as a food additive and is often utilized as a sugar substitute because it digests slower and doesn't cause a rapid increase in blood sugar levels.
How does Xylitol benefit the gut microbiome when consumed in foods?
Xylitol has prebiotic actions that positively influence the gut microbiome. It contains galactooligosaccharides, which contribute to its prebiotic abilities, supporting the growth of beneficial bacteria in the gut.
Can Xylitol help balance the bacteria on the skin's surface?
Yes, when combined with other oligosaccharides, xylitol can help maintain a balanced population of good and bad bacteria on the skin's surface, promoting a healthy skin microbiome.
What roles do Xylitol's humectant and prebiotic properties play in skincare?
As a humectant, xylitol aids in hydrating the skin by attracting moisture. Its prebiotic properties support the skin's microbiome, helping to keep the skin healthy and balanced.
How is Xylitol used in products, and at what concentrations?
Xylitol is used in cosmetics and skincare products typically at concentrations up to 10%. Lower amounts are often incorporated when combined with other humectants and prebiotics to enhance its beneficial properties.