Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0068 |
| Product Name | Tripeptide-1 |
| CAS | 72957-37-0 |
| Structure |  |
| Synonyms | N2-(N-glycyl-L-histidyl)-L-lysine monoacetate |
| IUPAC Name | acetic acid;(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| Molecular Weight | 400.44 g/mol |
| Molecular Formula | C16H28N6O6 |
| InChI | InChI=1S/C14H24N6O4.C2H4O2/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9;1-2(3)4/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24);1H3,(H,3,4)/t10-,11-;/m0./s1 |
| InChI Key | MGNUTAFMLGJBGV-ACMTZBLWSA-N |
| Purity | 0.95 |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | CC(=O)O.C1=C(NC=N1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)CN |
| Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula of Tripeptide-1?
The chemical formula of Tripeptide-1 is C16H28N6O6.
What is the molecular weight of Tripeptide-1?
The molecular weight of Tripeptide-1 is 400.44 g/mol.
What is the storage temperature recommended for Tripeptide-1?
The recommended storage temperature for Tripeptide-1 is -20°C.
What is the color of Tripeptide-1 in its powder form?
Tripeptide-1 is white in color in its powder form.
What is the sequence of amino acids in Tripeptide-1?
The sequence of amino acids in Tripeptide-1 is Gly-His-Lys.
What is the main use of Tripeptide-1?
Tripeptide-1 is used as a Liver Cell Growth Factor.
How does Tripeptide-1 stimulate collagen production in the skin?
Tripeptide-1 may mistakenly lead the skin to think that collagen has been broken down, resulting in more collagen production.
What is the general description of Gly-His-Lys in human blood plasma?
Gly-His-Lys is a tripeptide present at around 200ng/ml in association with α-globulin and albumin in human blood plasma.
What is the main biochem/physiol action of Gly-His-Lys (GHK) acetate salt?
Gly-His-Lys acetate salt displays affinity towards copper(II) ions and is involved in modulating copper intake into cells.
How can Gly-His-Lys acetate salt be used in studies?
Gly-His-Lys acetate salt can be used individually or as a complex with copper to test its effect on cytokines production in human normal fibroblasts cell lines.
If you have any questions, please contact us. You will get a satisfactory answer.
