Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1204 |
| Product Name | Trilinolein |
| CAS | 537-40-6 |
| Structure |  |
| Synonyms | (Z,Z)-9,12-Octadecadienoic acid, 1,2,3-propanetriyl ester;Glyceryl trilinoleate |
| IUPAC Name | 2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propyl (9Z,12Z)-octadeca-9,12-dienoate |
| Molecular Weight | 879.4 g/mol |
| Molecular Formula | C57H98O6 |
| InChI | InChI=1S/C57H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16-21,25-30,54H,4-15,22-24,31-53H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChI Key | HBOQXIRUPVQLKX-BBWANDEASA-N |
| Boiling Point | 816.5±65.0 °C |
| Melting Point | -5--4 °C |
| Purity | 95% |
| Density | 0.93 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0452 |
| Isomeric SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
What is the chemical name of Trilinolein?
Trilinolein can also be referred to as GLYCEROL TRI-9,12-OCTADECADIENOATE.
What is the molecular formula of Trilinolein?
The molecular formula of Trilinolein is C57H98O6.
What is the melting point of Trilinolein?
The melting point of Trilinolein is between -5 to -4 °C.
What is the boiling point of Trilinolein?
The predicted boiling point of Trilinolein is 816.5±65.0 °C.
What is the density of Trilinolein at 20°C?
The density of Trilinolein is 0.925 g/mL at 20°C.
In what type of solvents is Trilinolein sparingly soluble?
Trilinolein is sparingly soluble in chloroform and slightly soluble in hexanes.
What is the color of Trilinolein?
Trilinolein is colorless to pale yellow in color.
How is Trilinolein stored?
Trilinolein is stored at -20°C.
What is Trilinolein primarily used for?
Trilinolein is primarily used as an emollient to improve the look, feel, and texture of skin by replenishing lipids in the stratum corneum.
What risk statements are associated with Trilinolein?
Risk Statements 53 are associated with Trilinolein.
If you have any questions, please contact us. You will get a satisfactory answer.
