Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0065 |
| Product Name | Triethyl Citrate |
| CAS | 77-93-0 |
| Structure |  |
| Synonyms | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 1,2,3-triethyl ester;FEMA No. 3083 |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| Molecular Weight | 276.28 g/mol |
| Molecular Formula | C12H20O7 |
| InChI | InChI=1S/C12H20O7/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2/h16H,4-8H2,1-3H3 |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Boiling Point | 235 °C / 150mmHg |
| Melting Point | -55 °C |
| Purity | 95% |
| Density | 1.14 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
What is the chemical formula of Triethyl citrate?
The chemical formula of Triethyl citrate is C12H20O7.
What are the synonyms for Triethyl citrate?
The synonyms for Triethyl citrate include 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, triethyl ester, Citroflex 2, Crodamol TC, etc.
What is the boiling point of Triethyl citrate?
The boiling point of Triethyl citrate is 235 °C/150 mmHg.
How does Triethyl citrate smell?
Triethyl citrate is odorless.
What are the uses of Triethyl citrate?
Triethyl citrate is used as a flavoring agent in foods, plasticizer in the pharmaceutical industry, a natural active ingredient in cosmetics, a humectant for cigarette filters, and a food additive for stabilizing foams.
How is Triethyl citrate produced?
Triethyl citrate is prepared by the esterification of citric acid and ethanol in the presence of a catalyst.
Is Triethyl citrate considered safe as a direct food additive?
Yes, Triethyl citrate is considered a safe direct food additive.
How is Triethyl citrate described in terms of toxicity?
Triethyl citrate is categorized as moderately toxic by intraperitoneal route, mildly toxic by ingestion and inhalation. It is combustible when exposed to heat or flame.
What are the safety statements associated with Triethyl citrate?
The safety statements associated with Triethyl citrate include 24/25-45.
How should Triethyl citrate be stored?
Triethyl citrate should be stored in a closed container in a cool, dry location.
If you have any questions, please contact us. You will get a satisfactory answer.
