Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1220 |
| Product Name | Tricaprylin |
| CAS | 538-23-8 |
| Structure |  |
| Synonyms | 1,2,3-Tris-(octanoyloxy)-propane |
| IUPAC Name | 2,3-di(octanoyloxy)propyl octanoate |
| Molecular Weight | 470.69 g/mol |
| Molecular Formula | C27H50O6 |
| InChI | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3 |
| InChI Key | VLPFTAMPNXLGLX-UHFFFAOYSA-N |
| Melting Point | 9-10 °C |
| Flash Point | 225 °C |
| Purity | 95% |
| Density | 0.96 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.3169 |
| Isomeric SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
What is the chemical formula and molecular weight of TRIOCTANOIN?
The chemical formula is C27H50O6 and the molecular weight is 470.68.
What is the boiling point and vapor pressure of TRIOCTANOIN?
The boiling point of TRIOCTANOIN is 233°C/1 mmHg (lit.) and the vapor pressure is 0Pa at 25°C.
What is the solubility of TRIOCTANOIN in water?
TRIOCTANOIN is insoluble in water.
What are some synonyms of TRIOCTANOIN?
Some synonyms of TRIOCTANOIN are Caprylic triglyceride, Captex 8000, and Maceight.
How is TRIOCTANOIN used in pharmaceutical preparations?
TRIOCTANOIN is used as a neutral carrier, absorption promoter, and solubilizer for active drugs in pharmaceutical preparations.
What are the safety statements associated with TRIOCTANOIN?
The safety statements associated with TRIOCTANOIN are 23-24/25.
How is TRIOCTANOIN used in cosmetic formulations?
TRIOCTANOIN is used in cosmetic formulations as a penetration-enhancing lipid base with excellent emollient and skin-smoothing properties.
What are some potential safety concerns associated with TRIOCTANOIN?
TRIOCTANOIN may cause mild toxicity when ingested and show mild or moderate toxicity in animal studies.
What are some regulatory statuses of TRIOCTANOIN?
TRIOCTANOIN is included in the FDA Inactive Ingredients Database for epidural injections.
How should TRIOCTANOIN be stored to maintain stability?
TRIOCTANOIN should be stored in well-closed containers, protected from light, in a dry place at ambient temperature, and should be kept away from high temperatures near the flash point.
If you have any questions, please contact us. You will get a satisfactory answer.
