Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0043 |
| Product Name | Tetrapeptide-30 (skin lightening peptide) |
| CAS | 1036207-61-0 |
| Synonyms | Tetrapeptide-30 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-(pyrrolidine-2-carbonylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| Molecular Weight | 500.59 g/mol |
| Molecular Formula | C22H40N6O7 |
| InChI | InChI=1S/C22H40N6O7/c23-11-3-1-6-15(26-19(31)14-8-5-13-25-14)20(32)27-16(9-10-18(29)30)21(33)28-17(22(34)35)7-2-4-12-24/h14-17,25H,1-13,23-24H2,(H,26,31)(H,27,32)(H,28,33)(H,29,30)(H,34,35) |
| InChI Key | LYHZXMVNRVAAJA-UHFFFAOYSA-N |
| Boiling Point | 931.5±65.0 °C |
| Purity | 0.95 |
| Density | 1.26 g/mL |
| Appearance | White powder |
| Isomeric SMILES | C1CC(NC1)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| pKa | 3.24±0.10 |
What is the chemical formula of Tetrapeptide-30?
The chemical formula of Tetrapeptide-30 is C22H40N6O7.
What is the molecular weight of Tetrapeptide-30?
The molecular weight of Tetrapeptide-30 is 500.59 g/mol.
How should Tetrapeptide-30 be stored?
Tetrapeptide-30 should be stored at -20°C, protected from light, and stored under nitrogen.
What is the role of Tetrapeptide-30 in skin care products?
Tetrapeptide-30 acts as a tyrosinase inhibitor, lightening hyperpigmentation and evening out skin tone by reducing the amount of tyrosinase and inhibiting melanocyte activation.
What are the synonyms for Tetrapeptide-30?
Some synonyms for Tetrapeptide-30 include Teterapeptide-30 and Skin Lightening Peptide.
How does Tetrapeptide-30 help reduce melanin deposition?
Tetrapeptide-30 can reduce melanin deposition by acting as a tyrosinase inhibitor.
What is the boiling point of Tetrapeptide-30?
The predicted boiling point of Tetrapeptide-30 is 931.5±65.0 °C.
What is the InChIKey for Tetrapeptide-30?
The InChIKey for Tetrapeptide-30 is LYHZXMVNRVAAJA-PEFLOIOHNA-N.
How does Tetrapeptide-30 contribute to reducing melanin overproduction?
Tetrapeptide-30 reduces melanin overproduction by inhibiting melanocyte activation.
In what types of skin care products can Tetrapeptide-30 be added?
Tetrapeptide-30 can be added to skin care products such as skin cream, skin foundation, powder, and freckle cream.
If you have any questions, please contact us. You will get a satisfactory answer.
