Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1251 |
| Product Name | Tetramethyl Tetraphenyl Trisiloxane |
| CAS | 3982-82-9 |
| Structure |  |
| Synonyms | 1,3,3,5-Tetramethyl-1,1,5,5-tetraphenyltrisiloxane;Trisiloxane, 1,3,3,5-tetramethyl-1,1,5,5-tetraphenyl- |
| IUPAC Name | dimethyl-bis[[methyl(diphenyl)silyl]oxy]silane |
| Molecular Weight | 484.8 g/mol |
| Molecular Formula | C28H32O2Si3 |
| InChI | InChI=1S/C28H32O2Si3/c1-31(2,29-32(3,25-17-9-5-10-18-25)26-19-11-6-12-20-26)30-33(4,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24H,1-4H3 |
| InChI Key | YFCVAZGXPLMNDG-UHFFFAOYSA-N |
| Melting Point | -25 °C |
| Purity | 95% |
| Density | 1.07 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | C[Si](C)(O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2)O[Si](C)(C3=CC=CC=C3)C4=CC=CC=C4 |
What is the chemical name for Tetramethyl Tetraphenyl Trisiloxane?
The chemical name for Tetramethyl Tetraphenyl Trisiloxane is trimethyl-(methyl-phenyl-triphenylsilyloxysilyl)oxysilane.
What is the CAS number for Tetramethyl Tetraphenyl Trisiloxane?
The CAS number for Tetramethyl Tetraphenyl Trisiloxane is 103007-10-9.
What is the molecular formula for Tetramethyl Tetraphenyl Trisiloxane?
The molecular formula for Tetramethyl Tetraphenyl Trisiloxane is C28H32O2Si3.
What is the molecular weight of Tetramethyl Tetraphenyl Trisiloxane?
The molecular weight of Tetramethyl Tetraphenyl Trisiloxane is 484.80898.
How many silicon atoms are present in the structure of Tetramethyl Tetraphenyl Trisiloxane?
There are three silicon atoms present in the structure of Tetramethyl Tetraphenyl Trisiloxane.
What is the chemical structure of Tetramethyl Tetraphenyl Trisiloxane?
The chemical structure of Tetramethyl Tetraphenyl Trisiloxane is represented by the molecular formula C28H32O2Si3.
Can Tetramethyl Tetraphenyl Trisiloxane be used as a solvent?
Tetramethyl Tetraphenyl Trisiloxane can be used as a solvent in various applications.
Is Tetramethyl Tetraphenyl Trisiloxane commonly used in the pharmaceutical industry?
Yes, Tetramethyl Tetraphenyl Trisiloxane is commonly used in the pharmaceutical industry for various purposes.
What are the potential applications of Tetramethyl Tetraphenyl Trisiloxane in the cosmetic industry?
Tetramethyl Tetraphenyl Trisiloxane can be used in cosmetics as an emollient, conditioning agent, and solvent.
Why is Tetramethyl Tetraphenyl Trisiloxane considered to be a versatile compound?
Tetramethyl Tetraphenyl Trisiloxane is considered to be a versatile compound due to its ability to act as a solvent and be used in various industries such as pharmaceuticals and cosmetics.
If you have any questions, please contact us. You will get a satisfactory answer.
