Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1315 |
| Product Name | Serine |
| CAS | 56-45-1 |
| Structure |  |
| Synonyms | L-Serine |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid |
| Molecular Weight | 105.09 g/mol |
| Molecular Formula | C3H7NO3 |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 |
| InChI Key | MTCFGRXMJLQNBG-REOHCLBHSA-N |
| Melting Point | 222 °C |
| Purity | 95% |
| Density | 1.6 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.1125 |
| Isomeric SMILES | C([C@@H](C(=O)O)N)O |
Serine, a small-molecule nonessential amino acid, plays a crucial role in various physiological processes. It is a precursor to glycine, which is involved in collagen synthesis, thereby supporting skin structure and elasticity. As a component of natural moisturizing factors, serine helps prevent transepidermal water loss, ensuring optimal skin hydration. Additionally, L-serine is an integral part of specific phospholipids, such as phosphatidylserine, which are essential for maintaining cellular membrane integrity. Phosphatidylserine is known to enhance procollagen production while inhibiting the enzyme MMP-1, which breaks down collagen. Moreover, serine is necessary for the production of tryptophan, an amino acid that accelerates wound healing and skin recovery. Through these processes, serine contributes to maintaining healthy, hydrated skin and promoting healing.
What is Serine, and why is it important for skincare?
Serine is a small-molecule nonessential amino acid that plays a crucial role in skincare. As a precursor of Glycine, it is involved in collagen synthesis, which is vital for maintaining skin elasticity and strength. Additionally, Serine is a component of natural moisturizing factors (NMFs) that help prevent transepidermal water loss, ensuring the skin remains adequately hydrated.
How does Serine contribute to cellular membrane health?
Serine is an integral component of specific phospholipids, such as Phosphatidylserine, which are essential constituents of cellular membranes. Phosphatidylserine not only enhances procollagen production but also inhibits MMP-1, a collagen-destroying enzyme, thereby supporting the structural integrity of skin cells.
What is the relationship between Serine and wound healing?
L-Serine is involved in the production of tryptophan, an amino acid that accelerates the wound healing process and promotes skin recovery. By supporting essential proteins and amino acids in the skin, Serine aids in improving dermal fiber content and stimulating the body's natural healing mechanisms.
Can Serine be used to improve skin hydration?
Yes, Serine is a significant part of the natural moisturizing factors (NMFs) that maintain skin hydration by preventing water loss from the skin's surface. This helps to keep the skin optimally hydrated, contributing to a healthy and vibrant complexion.
How does Phosphatidylserine in Serine enhance collagen production?
Phosphatidylserine, a derivative of Serine, plays a pivotal role in boosting procollagen production, which is the precursor of collagen fibers. By inhibiting MMP-1, an enzyme that breaks down collagen, Phosphatidylserine supports the enhancement and preservation of collagen in the skin, ensuring firmness and elasticity.
If you have any questions, please contact us. You will get a satisfactory answer.
