Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1273 |
Product Name | Sarcosine |
CAS | 107-97-1 |
Structure | |
Synonyms | Glycine, N-methyl- |
IUPAC Name | 2-(methylamino)acetic acid |
Molecular Weight | 89.09 g/mol |
Molecular Formula | C3H7NO2 |
InChI | InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
InChI Key | FSYKKLYZXJSNPZ-UHFFFAOYSA-N |
Melting Point | 208-212 °C |
Purity | 95% |
Density | 1.19 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.0041 |
Highest Usage In Rinsing Products | 0.01 |
Isomeric SMILES | CNCC(=O)O |
pKa | 2.21 |
What is the chemical formula of Sarcosine?
The chemical formula of Sarcosine is C3H7NO2.
What are some synonyms for Sarcosine?
Some synonyms for Sarcosine include Methylglycine and N-methylglycine.
What is the melting point of Sarcosine?
The melting point of Sarcosine is 208-212 °C (dec.).
How is Sarcosine prepared in the laboratory?
Sarcosine can be synthesized through the reaction between chloroacetic acid and methylamine.
What is the biological function of Sarcosine?
Sarcosine reduces dihydrotestosterone (DHT) by inhibiting the enzyme 5 alpha-reductase.
What are some uses of Sarcosine?
Sarcosine is used in making toothpastes, biodegradable surfactants, and as a skin conditioner in cosmetic formulations.
What is the safety information associated with Sarcosine?
Sarcosine is a dietary supplement generally considered harmless, but some individuals may experience side effects such as euphoria and hyperactivity.
What is the pH of Sarcosine in H2O at 20°C?
The pH of Sarcosine in H2O at 20°C is 6.1.
What is the sensitivity of Sarcosine?
Sarcosine is described as hygroscopic, meaning it has a tendency to absorb moisture from the air.
How is Sarcosine used in the treatment of mental illness?
Sarcosine is thought to work by increasing glycine concentrations in the brain, which leads to increased NMDA receptor activation. This is seen as effective in the treatment of mental illnesses such as schizophrenia and depression.