Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1228 |
| Product Name | Retinyl Retinoate |
| CAS | 15498-86-9 |
| Synonyms | Retinyl Retinoate Liposome, Retinyl Retinoate NanoEmulsion, Water Soluble Retinyl Retinoate |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| Molecular Weight | 568.9 g/mol |
| Molecular Formula | C40H56O2 |
| InChI | InChI=1S/C40H56O2/c1-30(21-23-36-34(5)19-13-26-39(36,7)8)15-11-17-32(3)25-28-42-38(41)29-33(4)18-12-16-31(2)22-24-37-35(6)20-14-27-40(37,9)10/h11-12,15-18,21-25,29H,13-14,19-20,26-28H2,1-10H3/b17-11+,18-12+,23-21+,24-22+,30-15+,31-16+,32-25+,33-29+ |
| InChI Key | QNCTWCFXYGJGKU-CHOOPKNISA-N |
| Boiling Point | 671.0±24.0 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0012 |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/COC(=O)/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(CCCC2(C)C)C)/C)/C |
How is Retinyl Retinoate used in skin treatment?
Retinyl Retinoate is used topically on the skin to help treat conditions such as acne, psoriasis, and photoaging by promoting skin cell turnover and renewal.
What are some synonyms for Retinyl Retinoate?
Some synonyms for Retinyl Retinoate are Nano Liposomal Retinyl Retinoate, Retinyl Retinoate, r-Retinoate, and Retinyl Retinoate Liposome.
What is the chemical formula for Retinyl Retinoate?
The chemical formula for Retinyl Retinoate is C40H56O2.
What is the molecular weight of Retinyl Retinoate?
The molecular weight of Retinyl Retinoate is 568.87 g/mol.
What are the chemical properties of Retinyl Retinoate?
The boiling point of Retinyl Retinoate is predicted to be 671.0±24.0 °C, and its density is predicted to be 0.980±0.06 g/cm3. It is stored in an Amber Vial at -20°C freezer under an inert atmosphere.
In what form is Retinyl Retinoate available?
Retinyl Retinoate is available in solid form and appears as light yellow to yellow oil to waxy in color.
What is the solubility of Retinyl Retinoate?
Retinyl Retinoate is slightly soluble in chloroform, ethyl acetate, and methanol.
What is the stability of Retinyl Retinoate?
Retinyl Retinoate is light sensitive.
What are the uses of Retinyl Retinoate?
Retinyl Retinoate is used in the treatment of skin diseases and disorders such as acne, psoriasis, and photoaging.
If you have any questions, please contact us. You will get a satisfactory answer.
