Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0009 |
| Product Name | Retinol |
| CAS | 11103-57-4 |
| Structure |  |
| Synonyms | Vitamin A1 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| Molecular Weight | 286.45 g/mol |
| Molecular Formula | C20H30O |
| InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChI Key | FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
| Purity | 98% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C |
Retinol, a potent form of vitamin A, is frequently utilized in skin care products due to its broad spectrum of benefits. When applied topically, retinol enhances skin elasticity promotes the thickening of the epidermis and dermis, and is instrumental in normalizing dry skin and reversing photodamage. It is also beneficial in reducing scalp scaliness and improving hair condition when incorporated into hair care formulations. However retinol's efficacy can be challenged by its inherent instability; it is sensitive to temperature, oxygen and light, which necessitates careful formulation and packaging strategies. These include adding antioxidants such as tocopherol and ascorbyl palmitate, ensuring an optimal pH level and using opaque packaging to mitigate exposure to environmental factors. Despite these challenges, retinol remains a preferred option for enhancing skin and hair health, provided that these stability considerations are carefully managed.
What are the primary benefits of using Retinol for skin care?
Retinol activates fibroblasts, which enhances collagen production. This process thickens both the epidermis and dermis, effectively reducing wrinkles and fine lines. Additionally, Retinol is known for reversing photodamage and photoaging, which are caused by UV light reducing Vitamin A levels in the skin and activating collagenase that breaks down collagen in connective tissues.
How does Retinol interact with photodamaged skin?
Retinol treatment is particularly effective on photodamaged skin. It helps reverse the effects of photodamage by correcting Atrophy and Atypia, increasing the granular layer with larger granules, improving cell differentiation, and enlarging the intercellular spaces within the epidermis. This helps rejuvenate and restore the structure and appearance of damaged skin.
Can Retinol be considered a preventative ingredient against cancer?
Yes, Retinol can be considered a cancer preventative ingredient, particularly due to its role in combating squamous metaplasia. By assisting in the maintenance and function of mucous membranes, Retinol serves a protective role that may help in reducing cancer risks associated with mucous membrane disruptions.
Is Retinol effective in treating any specific conditions beyond general skin aging?
Beyond its anti-aging benefits, Retinol is also beneficial in the treatment of certain conditions such as senile vaginitis. It enhances the structure and function of mucous membranes, providing therapeutic advantages in vitamin A deficient states where mucous production is compromised.
How does Vitamin A deficiency affect the skin and how does Retinol help?
A deficiency in Vitamin A can lead to reduced mucous production and compromised mucous membrane function. Retinol replenishes Vitamin A levels, which is essential for maintaining the integrity of mucous membranes. It aids in the restoration of normal skin function and appearance, particularly in areas of deficiency.
If you have any questions, please contact us. You will get a satisfactory answer.
