Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0009 |
| Product Name | Retinol |
| CAS | 11103-57-4 |
| Structure |  |
| Synonyms | Vitamin A1 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| Molecular Weight | 286.45 g/mol |
| Molecular Formula | C20H30O |
| InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChI Key | FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
| Purity | 98% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C |
What is the chemical formula of all-trans-Retinol?
The chemical formula of all-trans-Retinol is C20H30O.
What is the melting point of all-trans-Retinol?
The melting point of all-trans-Retinol is 61-63°C.
What are some synonyms for all-trans-Retinol?
Some synonyms for all-trans-Retinol include Vitamin A1 alcohol, Vitavel A, and Vitamin-A-ALCOHOL SOLUTION.
What are the hazard codes associated with all-trans-Retinol?
The hazard codes associated with all-trans-Retinol are Xn, N, F, T.
How is all-trans-Retinol commonly used in skincare products?
all-trans-Retinol is used in skincare products as a skin revitalizer that can treat conditions such as wrinkles, fine lines, acne, and rosacea.
What is the main source of vitamin A in the human body?
The main source of vitamin A in the human body is through food, particularly animal tissues and plant sources like carotenoids.
What are some safety precautions to take when handling all-trans-Retinol?
Some safety precautions when handling all-trans-Retinol include storing it at -20°C, protecting it from light and air, and avoiding contact with strong acids and oxidizing agents.
How is all-trans-Retinol involved in bone development?
Adequate intake of all-trans-Retinol is linked to bone development and growth in children.
What are some potential therapeutic functions of all-trans-Retinol?
Some potential therapeutic functions of all-trans-Retinol include treating wrinkles, signs of aging, dermatological disorders, and maintaining the structural integrity of epithelial cells.
How is all-trans-Retinol involved in the visual function of the human body?
all-trans-Retinol is involved in the visual function of the human body by being transformed into all-trans-retinal under light induction, which is crucial for the visual cycle and dark adaptation in the eyes.
If you have any questions, please contact us. You will get a satisfactory answer.
