Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1182 |
Product Name | Propylene Glycol Distearate |
CAS | 6182-11-2 |
Structure | |
Synonyms | Octadecanoic acid, 1-methyl-1,2-ethanediyl ester |
IUPAC Name | 2-octadecanoyloxypropyl octadecanoate |
Molecular Weight | 609 g/mol |
Molecular Formula | C39H76O4 |
InChI | InChI=1S/C39H76O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38(40)42-36-37(3)43-39(41)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h37H,4-36H2,1-3H3 |
InChI Key | JEMDXOYRWHZUCG-UHFFFAOYSA-N |
Boiling Point | 640.5±28.0 °C |
Purity | 95% |
Density | 0.89 g/mL |
Appearance | Solid |
Highest Usage In Rinsing Products | 0.1 |
Isomeric SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(C)OC(=O)CCCCCCCCCCCCCCCCC |
What is the chemical formula of Propylene Glycol Distearate?
The chemical formula of Propylene Glycol Distearate is C39H76O4.
What is the molecular weight of Propylene Glycol Distearate?
The molecular weight of Propylene Glycol Distearate is 609.02.
What are some synonyms for Propylene Glycol Distearate?
Some synonyms for Propylene Glycol Distearate are EMALEX PG-DI-S and PROPYLENE GLYCOL DISTEARATE.
What is the EINECS number for Propylene Glycol Distearate?
The EINECS number for Propylene Glycol Distearate is 228-229-3.
Can Propylene Glycol Distearate be used in leave-on and rinse-off products?
Yes, Propylene Glycol Distearate can be used in both leave-on and rinse-off products due to its versatility as an emulsifier and emollient.
What is the common use of Propylene Glycol Distearate in products?
Propylene Glycol Distearate is commonly used as an emollient and emulsifier in cosmetic and personal care products.
Is Propylene Glycol Distearate a water-soluble or oil-soluble ingredient?
Propylene Glycol Distearate is an oil-soluble ingredient.
How does Propylene Glycol Distearate affect the texture of products?
Propylene Glycol Distearate helps to give products a smooth and creamy texture.
What are some potential benefits of using Propylene Glycol Distearate in formulations?
Some potential benefits of using Propylene Glycol Distearate include enhanced moisturization, skin conditioning, and improved product stability.