Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1210 |
Product Name | Propylene Glycol Dicaprylate |
CAS | 7384-98-7 |
Structure | ![]() |
Synonyms | 1,2-Propylene glycol dicaprylate |
IUPAC Name | 2-octanoyloxypropyl octanoate |
Molecular Weight | 328.5 g/mol |
Molecular Formula | C19H36O4 |
InChI | InChI=1S/C19H36O4/c1-4-6-8-10-12-14-18(20)22-16-17(3)23-19(21)15-13-11-9-7-5-2/h17H,4-16H2,1-3H3 |
InChI Key | OVYMWJFNQQOJBU-UHFFFAOYSA-N |
Boiling Point | 397.7±15.0 °C |
Purity | 95% |
Density | 0.94 g/mL |
Appearance | Liquid |
Highest Usage In Residency Products | 0.4 |
Isomeric SMILES | CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC |
What is the molecular formula of propylene di(octanoate)?
The molecular formula of propylene di(octanoate) is C19H36O4.
What is the CAS number for propylene di(octanoate)?
The CAS number for propylene di(octanoate) is 7384-98-7.
What is the boiling point of propylene di(octanoate)?
The boiling point of propylene di(octanoate) is predicted to be 397.7±15.0 °C.
What is the density of propylene di(octanoate)?
The density of propylene di(octanoate) is predicted to be 0.939±0.06 g/cm3.
What is the odor of propylene di(octanoate)?
The odor of propylene di(octanoate) is described as fatty fruity.
How is propylene di(octanoate) stored?
Propylene di(octanoate) should be sealed in dry conditions at room temperature.
In what industry is propylene di(octanoate) commonly used?
Propylene di(octanoate) is commonly used in the cosmetic industry in creams, lotions, and topicals.
What is the LogP value of propylene di(octanoate)?
The LogP value of propylene di(octanoate) is 6.67.
What is the FEMA number for propylene di(octanoate)?
The FEMA number for propylene di(octanoate) is 4471.
What is the EINECS number for propylene di(octanoate)?
The EINECS number for propylene di(octanoate) is 230-962-9.