Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0011 |
| Product Name | POE 20 methyl glucose |
| CAS | 68239-42-9 |
| Synonyms | Methyl gluceth-20 |
| IUPAC Name | 2-[[(2R,6R)-3,4,5-tris(2-hydroxyethoxy)-6-methoxyoxan-2-yl]methoxy]ethanol |
| Molecular Weight | 370.39 g/mol |
| Molecular Formula | C15H30O10 |
| InChI | InChI=1S/C15H30O10/c1-20-15-14(24-9-5-19)13(23-8-4-18)12(22-7-3-17)11(25-15)10-21-6-2-16/h11-19H,2-10H2,1H3/t11-,12?,13?,14?,15-/m1/s1 |
| InChI Key | UITSPQLTFPTHJZ-XTLGRWLVSA-N |
| Isomeric SMILES | CO[C@H]1C(C(C([C@H](O1)COCCO)OCCO)OCCO)OCCO |
What is the chemical equation for METHYL GLUCETH-20?
The chemical equation for METHYL GLUCETH-20 is C15H30O10.
What are some synonyms for METHYL GLUCETH-20?
Some synonyms for METHYL GLUCETH-20 are methyl glucose-20, POE 20 methyl glucose, and MethylGluceth.
What is the CAS number for METHYL GLUCETH-20?
The CAS number for METHYL GLUCETH-20 is 68239-42-9.
What are the basic properties of METHYL GLUCETH-20?
The basic properties of METHYL GLUCETH-20 include a bland odor and a LogP value of -4.430.
What is the EPA Substance Registry System number for Methyl gluceth?
The EPA Substance Registry System number for Methyl gluceth is 68239-42-9.
What are the product categories that METHYL GLUCETH-20 belongs to?
METHYL GLUCETH-20 belongs to the product category of Polymers.
What is the molecular weight of METHYL GLUCETH-20?
The molecular weight of METHYL GLUCETH-20 is 370.3927.
What is the EINECS number for METHYL GLUCETH-20?
The EINECS number for METHYL GLUCETH-20 is 000-000-0.
What is the main usage of METHYL GLUCETH-20?
METHYL GLUCETH-20 is mainly used as a humectant skin-conditioning agent.
From which company can you purchase E-20, another name for METHYL GLUCETH-20?
E-20, another name for METHYL GLUCETH-20, can be purchased from Amerchol of Dow.
If you have any questions, please contact us. You will get a satisfactory answer.
