Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1229 |
| Product Name | Phytosphingosine |
| CAS | 13552-11-9 |
| Structure |  |
| Synonyms | 3,4-Octadecanetriol, 2-amino-1 |
| IUPAC Name | 2-aminooctadecane-1,3,4-triol |
| Molecular Weight | 317.5 g/mol |
| Molecular Formula | C18H39NO3 |
| InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3 |
| InChI Key | AERBNCYCJBRYDG-UHFFFAOYSA-N |
| Boiling Point | 483.5±40.0 °C |
| Melting Point | 136-138 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | CCCCCCCCCCCCCCC(C(C(CO)N)O)O |
What is the chemical formula of phytosphingosine?
The chemical formula of phytosphingosine is C18H39NO3.
What is the molecular weight of phytosphingosine?
The molecular weight of phytosphingosine is 317.51 g/mol.
What is the boiling point of phytosphingosine?
The boiling point of phytosphingosine is predicted to be 483.7±40.0 °C.
What is the InChIKey of phytosphingosine?
The InChIKey of phytosphingosine is AERBNCYCJBRYDG-UHFFFAOYSA-N.
How can phytosphingosine be used in skin care?
Phytosphingosine can be used as an oat lipid extraction for applying on skin care.
What is the biological function of phytosphingosine in plants?
Phytosphingosine is a major LCB in some plants and is involved in cell signaling.
When does phytosphingosine accumulate in Arabidopsis leaves after pathogen inoculation?
Phytosphingosine accumulates as early as 1 hour after pathogen inoculation with virulent and avirulent strains of Pseudomonas syringae pv. tomato in Arabidopsis leaves.
How is phytosphingosine involved in systemic acquired resistance in plants?
Phytosphingosine induces systemic acquired resistance through activation of sphingosine kinase.
What are some synonyms for phytosphingosine?
Some synonyms for phytosphingosine include 3,4-Octadecanetriol, 2-amino-1; Nano-Liposomal PHYTOSPHINGOSINE; and 2-Amino-1,3,4-octadecanetriol.
What is the pka of phytosphingosine (predicted)?
The pka of phytosphingosine is predicted to be 11.91±0.45.
If you have any questions, please contact us. You will get a satisfactory answer.
