Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0190 |
| Product Name | Phenoxyisopropanol |
| CAS | 770-35-4 |
| Structure |  |
| Synonyms | Propylene glycol phenyl ether;1-Phenoxypropan-2-ol;2-Propanol, 1-phenoxy- |
| IUPAC Name | 1-phenoxypropan-2-ol |
| Molecular Weight | 152.19 g/mol |
| Molecular Formula | C9H12O2 |
| InChI | InChI=1S/C9H12O2/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChI Key | IBLKWZIFZMJLFL-UHFFFAOYSA-N |
| Boiling Point | 243 °C |
| Melting Point | 11 °C |
| Purity | 95% |
| Density | 1.06 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CC(COC1=CC=CC=C1)O |
What is the molecular formula of 1-Phenoxy-2-propanol?
The molecular formula of 1-Phenoxy-2-propanol is C9H12O2.
What is the boiling point of 1-Phenoxy-2-propanol?
The boiling point of 1-Phenoxy-2-propanol is 243°C.
Is 1-Phenoxy-2-propanol soluble in water?
Yes, 1-Phenoxy-2-propanol is soluble in water (15.1g/L at 20°C).
What are the safety codes associated with 1-Phenoxy-2-propanol?
The hazard code is Xi, the risk statement is 36, and the safety statements are 23-26.
What is the toxicity level of 1-Phenoxy-2-propanol?
The LD50 for oral ingestion in rats is 2830 mg/kg.
How is 1-Phenoxy-2-propanol commonly used?
It is used as a high-boiling solvent, bactericidal agent, fixative for soaps and perfumes, and as an intermediate for plasticizers.
How is 1-Phenoxy-2-propanol synthesized?
It can be synthesized by reacting propylene oxide with phenol in the presence of Al2O3-MgO/Fe3O4 catalyst.
Is 1-Phenoxy-2-propanol a flammable substance?
No, 1-Phenoxy-2-propanol is non-flammable.
What are the potential health risks associated with 1-Phenoxy-2-propanol?
It is moderately toxic by ingestion and skin contact, with experimental reproductive effects.
What is the specific gravity of 1-Phenoxy-2-propanol?
The specific gravity of 1-Phenoxy-2-propanol is 1.051.
If you have any questions, please contact us. You will get a satisfactory answer.
