Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0128 |
| Product Name | Pectin |
| CAS | 9000-69-5 |
| Synonyms | Polyhalactyronic acid |
| Description | Pectin is a naturally occurring polysaccharide (complex carbohydrate) found in the cell walls of fruits and vegetables. |
| IUPAC Name | 2,3,4,5-tetrahydroxypentanal |
| Molecular Formula | C5H10O5 |
| Canonical SMILES | C(C(C(C(C=O)O)O)O)O |
| InChI | PYMYPHUHKUWMLA-UHFFFAOYSA-N |
| InChI Key | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Melting Point | 174-180 °C(dec.) |
| Flash Point | 219.2°C |
| Density | 1.508 g/mL |
| Appearance | white to light yellow powder and it is odorless |
| Application | 1. Food thickener: Pectin is commonly used in food as a gelling agent and thickener. It is particularly useful in making jams, jellies, and fruit preserves. 2. Constipation relief: Pectin has a mild laxative effect and can help relieve symptoms of constipation. 3. Cholesterol reduction: Pectin can bind with cholesterol in the intestine, reducing its absorption and potentially lower blood cholesterol levels. 4. Blood sugar control: Pectin can slow down the absorption of carbohydrates, which can help regulate blood sugar levels in people with diabetes. 5. Wound healing: Pectin has been shown to accelerate the healing of certain types of wounds, possibly by promoting cell growth. 6. Industrial uses: Pectin is used in the industrial production of textiles, paper, and cosmetics. |
| Storage | storage temp. 2-8°C |
| Features And Benefits | 1. Pectin in cosmetics can improve skin hydration. 2. Pectin can improve the texture and spreadability of creams and lotions. 3. It can act as a thickening agent in cosmetic formulations. 4. Pectin can help to stabilize emulsions. 5. It has a mild exfoliating effect and can improve skin tone and texture. |
| Refractive Index | 1.543 |
If you have any questions, please contact us. You will get a satisfactory answer.
