Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1301 |
| Product Name | PCA |
| CAS | 98-79-3 |
| Structure |  |
| Synonyms | L-2-Pyrrolidone-5-Carboxylate |
| IUPAC Name | (2S)-5-oxopyrrolidine-2-carboxylic acid |
| Molecular Weight | 129.11 g/mol |
| Molecular Formula | C5H7NO3 |
| InChI | InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChI Key | ODHCTXKNWHHXJC-VKHMYHEASA-N |
| Boiling Point | 239 °C |
| Melting Point | 160-163 °C |
| Purity | 0.98 |
| Density | 1.38 g/mL |
| Appearance | White to off-white solid |
| Highest Usage In Residency Products | 0.0184 |
| Isomeric SMILES | C1CC(=O)N[C@@H]1C(=O)O |
| pKa | 3.32 |
If you have any questions, please contact us. You will get a satisfactory answer.
