Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1276 |
| Product Name | Panthenol |
| CAS | 81-13-0 |
| Structure |  |
| Synonyms | Panthenol;D-Pantothenol;Butyramide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, D-(+)-;Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, (2R)-;Provitamin B5 |
| IUPAC Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| Molecular Weight | 205.25 g/mol |
| Molecular Formula | C9H19NO4 |
| InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
| InChI Key | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
| Boiling Point | 118-120 °C / 2.7mmHg |
| Melting Point | 64-69 °C |
| Purity | 95% |
| Density | 1.2 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.4 |
| Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCCO)O |
What is the chemical structure of Panthenol?
The chemical structure of Panthenol is C9H19NO4.
What is the purpose of using Panthenol in pharmaceutical and cosmetic products?
Panthenol is used as a moisturizer and to improve wound healing in pharmaceutical and cosmetic products.
How is Panthenol converted in the body?
Panthenol is quickly oxidized to pantothenic acid in organisms.
What are the solubility properties of Panthenol?
Panthenol is soluble in water, ethanol, ether, chloroform, and propylene glycol.
What are the safety hazard codes associated with Panthenol?
The hazard code for Panthenol is Xn.
What is the mechanism of action of Panthenol in the skin?
Panthenol is absorbed into the skin and converted into Pantothenic acid, which is essential for various biochemical reactions sustaining life.
What are some side effects associated with Panthenol use?
In rare cases, skin irritation and contact allergies have been reported with the use of Panthenol.
How does Panthenol act as a moisturizer and conditioner in skin and hair care products?
Panthenol acts as a penetrating moisturizer, stimulates cellular proliferation, aids in tissue repair, and enhances skin suppleness.
How does Panthenol protect the skin against sunburn?
Panthenol protects the skin against sunburn, provides relief for existing sunburn, and enhances the natural tanning process.
What are some of the uses of Panthenol in skin and hair care applications?
Panthenol is used in the treatment of skin disorders, minor irritations, skin burns, strengthening and treatment of hair, and as a moisturizer and conditioner in various products.
If you have any questions, please contact us. You will get a satisfactory answer.
