Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1276 |
| Product Name | Panthenol |
| CAS | 81-13-0 |
| Structure |  |
| Synonyms | Panthenol;D-Pantothenol;Butyramide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, D-(+)-;Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl-, (2R)-;Provitamin B5 |
| IUPAC Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| Molecular Weight | 205.25 g/mol |
| Molecular Formula | C9H19NO4 |
| InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
| InChI Key | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
| Boiling Point | 118-120 °C / 2.7mmHg |
| Melting Point | 64-69 °C |
| Purity | 95% |
| Density | 1.2 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.4 |
| Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCCO)O |
Panthenol, a provitamin form of Vitamin B5, plays an instrumental role in skincare haircare and nail care due to its multi-functional properties. As a key component of coenzyme A, panthenol facilitates essential biochemical processes including synthesis of lipids and proteins. In skincare, it acts as a deep-penetrating moisturizer promoting cell proliferation and aiding in tissue repair and normal keratinization, which may enhance wound healing and alleviate various dermatological conditions. For hair, panthenol penetrates rapidly and binds strongly with amino acids, providing long-lasting moisturization that protects against brittleness and breakage strengthens hair and reduces damage from heat and dryness. Additionally, it nourishes and conditions hair without leaving any buildup, and helps prevent split-ends. In nail care, panthenol is absorbed into the nail matrix reducing brittleness and enhancing nail strength.
What is Panthenol, and how does it relate to Vitamin B5?
Panthenol is a provitamin of pantothenic acid (vitamin B5), belonging to the B-complex group of water-soluble vitamins. It is an alcohol form of the D-isomer of pantothenic acid and plays a crucial role as a constituent of coenzyme A. Coenzyme A is fundamental for acetylation reactions, which are essential for synthesizing lipids, proteins, and the connection between lipids, proteins, and carbohydrates.
How does Panthenol benefit the skin?
Panthenol acts as a quick, deep-penetrating moisturizer, which can stimulate fibroblast proliferation and assist in tissue repair. It is also claimed to promote normal keratinization and wound healing in various skin conditions such as surgical, traumatic, and thermally induced wounds. Additionally, Panthenol is considered effective in treating dermatological disorders like atopic dermatitis, diaper rash, and itching.
What are the benefits of Panthenol in hair care?
In hair care, Panthenol (pro-vitamin B5) converts to pantothenic acid, a natural component of healthy hair. It enhances hair strength and increases resistance to breakage while preventing damage from excessive heat and dryness. Panthenol nourishes by replenishing and increasing vitamin B5 levels in the hair, providing long-lasting moisturization, conditioning without build-up, and reducing split-end formation.
Can Panthenol be used for nail care?
Yes, Panthenol is beneficial in nail care as it is absorbed into the nails, helping to reduce brittleness. By penetrating the nail structure, it improves nail flexibility and strength.
Are there any known side effects or concerns with using Panthenol?
Panthenol is generally considered safe and well-tolerated for topical use in various products, including skin, hair, and nail care. However, users should follow the specific product's instructions and consult a healthcare professional if they experience any adverse reactions or have concerns about the product's suitability for their skin type or condition.
If you have any questions, please contact us. You will get a satisfactory answer.
