Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1275 |
Product Name | Pantethine |
CAS | 16816-67-4 |
Structure | |
Synonyms | D-Pantethine |
IUPAC Name | (2R)-N-[3-[2-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
Molecular Weight | 554.72 g/mol |
Molecular Formula | C22H42N4O8S2 |
InChI | InChI=1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34)/t17-,18-/m0/s1 |
InChI Key | DJWYOLJPSHDSAL-ROUUACIJSA-N |
Boiling Point | 987.2±65.0 °C |
Purity | 95% |
Density | 1.19 g/mL |
Appearance | Liquid |
Highest Usage In Residency Products | 0.005 |
Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO)O)O |
What is the chemical formula of Pantethine?
The chemical formula of Pantethine is C22H42N4O8S2.
What is the molecular weight of Pantethine?
The molecular weight of Pantethine is 554.72.
What is Pantethine commonly used for?
Pantethine is commonly used as an emollient and conditioner in hair care preparations.
What are some properties of Pantethine that make it useful in hair care products?
Pantethine is an emollient which helps to soften and smooth the hair, making it a popular ingredient in hair care products.
What is the role of Pantethine in hair care products?
Pantethine acts as a conditioning agent, helping to improve the overall appearance and texture of hair.
What is the structure of Pantethine?
The structure of Pantethine includes two molecules of pantothenic acid linked by a cysteamine bridge.
How does Pantethine benefit hair?
Pantethine helps to strengthen hair and reduce breakage, leading to healthier and more resilient hair.
Can Pantethine be used in other types of personal care products?
Yes, Pantethine can also be found in skincare products due to its emollient and conditioning properties.
Is Pantethine a synthetic or natural ingredient?
Pantethine is a synthetic ingredient derived from pantothenic acid, also known as vitamin B5.
What is the difference between Pantethine and pantothenic acid?
Pantethine is a dimer of pantothenic acid, meaning it consists of two pantothenic acid molecules linked together by a cysteamine bridge.