Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0004 |
Product Name | Pal-tetrapeptide-3/7 |
CAS | 221227-05-0 |
Structure | |
Synonyms | Palmitoyl tetrapeptide-7 |
IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-5-amino-2-[[2-(hexadecanoylamino)acetyl]amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
Molecular Weight | 694.91 g/mol |
Molecular Formula | C34H62N8O7 |
InChI | InChI=1S/C34H62N8O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-29(44)39-24-30(45)40-25(20-21-28(35)43)32(47)42-23-16-18-27(42)31(46)41-26(33(48)49)17-15-22-38-34(36)37/h25-27H,2-24H2,1H3,(H2,35,43)(H,39,44)(H,40,45)(H,41,46)(H,48,49)(H4,36,37,38)/t25-,26-,27-/m0/s1 |
InChI Key | IHRKJQSLKLYWBQ-QKDODKLFSA-N |
Purity | 0.95 |
Density | 1.26 g/mL |
Appearance | Solid |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)NCC(=O)N[C@@H](CCC(=O)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
pKa | 3.60±0.21 |
What is the chemical formula of Palmitoyl tetrapeptide-7?
The chemical formula of Palmitoyl tetrapeptide-7 is C34H62N8O7.
What is Palmitoyl tetrapeptide-7 commonly known as in the beauty industry?
Palmitoyl tetrapeptide-7 is commonly known as Matrixyl 3000.
What is the role of Palmitoyl tetrapeptide-7 in cosmetics?
Palmitoyl tetrapeptide-7 is used in cosmetics for its anti-aging and skin repair properties.
What amino acids is Palmitoyl tetrapeptide-7 composed of?
Palmitoyl tetrapeptide-7 is composed of the amino acids glycine, glutamine, proline, and arginine.
Why is palmitic acid added to Palmitoyl tetrapeptide-7?
Palmitic acid is added to Palmitoyl tetrapeptide-7 to enhance its stability and permeability to the skin.
How does Palmitoyl tetrapeptide-7 work in reducing skin aging?
Palmitoyl tetrapeptide-7 reduces the production of interleukin-6 (IL-6) by key cells in the skin, leading to reduced inflammation and protection of extracellular matrix components.
What is one of the key benefits of using Palmitoyl tetrapeptide-7 in beauty products?
One key benefit of using Palmitoyl tetrapeptide-7 is the suppression of excess interleukins, which can help prevent glycation damage and maintain the skin's support system.
What can happen if skin experiences excess interleukins?
Excess interleukins in the skin can lead to glycation damage, causing stiffening of tissues, wrinkles, sagging, and uneven skin tone.
How is Palmitoyl tetrapeptide-7 stored?
Palmitoyl tetrapeptide-7 is typically stored under inert gas (nitrogen or Argon) at temperatures of 2-8°C.
What is the mechanism of action of Palmitoyl tetrapeptide-7?
The mechanism of action of Palmitoyl tetrapeptide-7 involves reducing the production of interleukin-6 and other pro-inflammatory agents, thus protecting the skin's extracellular matrix components and promoting a younger-looking appearance.