Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0032 |
| Product Name | Oleamidopropyl Dimethylamine |
| CAS | 109-28-4 |
| Structure |  |
| Synonyms | Dimethylaminopropyl oleamide;9-Octadecenamide, N-(3-(dimethylamino)propyl)-, (9Z)-;N-(3-(Dimethylamino)propyl)oleamide |
| IUPAC Name | (Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide |
| Molecular Weight | 366.6 g/mol |
| Molecular Formula | C23H46N2O |
| InChI | InChI=1S/C23H46N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h11-12H,4-10,13-22H2,1-3H3,(H,24,26)/b12-11- |
| InChI Key | UCWYGNTYSWIDSW-QXMHVHEDSA-N |
| Boiling Point | 239 °C |
| Purity | 95% |
| Density | 0.89 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCN(C)C |
What is the chemical formula of Oleamidopropyl dimethylamine?
The chemical formula of Oleamidopropyl dimethylamine is C23H46N2O.
What is the molecular weight of Oleamidopropyl dimethylamine?
The molecular weight of Oleamidopropyl dimethylamine is 366.62 g/mol.
What is the boiling point of Oleamidopropyl dimethylamine?
The boiling point of Oleamidopropyl dimethylamine is 239℃.
What is the density of Oleamidopropyl dimethylamine at 20℃?
The density of Oleamidopropyl dimethylamine is 0.894 at 20℃.
What is the water solubility of Oleamidopropyl dimethylamine at 20℃?
The water solubility of Oleamidopropyl dimethylamine is 1.26g/L at 20℃.
What is the logP value of Oleamidopropyl dimethylamine at 22℃?
The logP value of Oleamidopropyl dimethylamine at 22℃ is 1.842.
What is one common usage of Oleamidopropyl dimethylamine?
Oleamidopropyl dimethylamine is commonly used as a cationic emulsifier in cosmetics, such as body lotions, creams, shampoos, and hair rinse preparations.
Is Oleamidopropyl dimethylamine flammable?
No, Oleamidopropyl dimethylamine is non-flammable.
What is another name for Oleamidopropyl dimethylamine?
Another name for Oleamidopropyl dimethylamine is OleylamidopropylDimethylAmine.
What is the predicted pka value of Oleamidopropyl dimethylamine?
The predicted pka value of Oleamidopropyl dimethylamine is 16.29±0.46.
If you have any questions, please contact us. You will get a satisfactory answer.
