Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1199 |
Product Name | Neopentyl Glycol Diheptanoate |
CAS | 68855-18-5 |
Structure | |
Synonyms | 2,2-dimethylpropane-1,3-diyl bisheptanoate |
IUPAC Name | 2,2-dimethylpropane-1,3-diol;heptanoic acid |
Molecular Weight | 328.5 g/mol |
Molecular Formula | C19H36O4 |
InChI | InChI=1S/C7H14O2.C5H12O2/c1-2-3-4-5-6-7(8)9;1-5(2,3-6)4-7/h2-6H2,1H3,(H,8,9);6-7H,3-4H2,1-2H3 |
InChI Key | VRYUGRNJSPQWJC-UHFFFAOYSA-N |
Purity | 95% |
Density | 0.92 g/mL |
Highest Usage In Residency Products | 0.4509 |
Isomeric SMILES | CCCCCCC(=O)O.CC(C)(CO)CO |
What is the chemical formula for Neopentyl glycol diheptanoate?
The chemical formula for Neopentyl glycol diheptanoate is C19H36O4.
What is the molecular weight of Neopentyl glycol diheptanoate?
The molecular weight of Neopentyl glycol diheptanoate is 328.48674.
What is the density of Neopentyl glycol diheptanoate at 20℃?
The density of Neopentyl glycol diheptanoate at 20℃ is 0.92.
What is the CAS number for Neopentyl glycol diheptanoate?
The CAS number for Neopentyl glycol diheptanoate is 68855-18-5.
What is the main usage of Neopentyl glycol diheptanoate?
Neopentyl glycol diheptanoate is used as a skin-conditioning and viscosity increasing agent, as well as an emollient.
Is Neopentyl glycol diheptanoate flammable?
No, Neopentyl glycol diheptanoate is non-flammable.
What is another name for Neopentyl glycol diheptanoate?
Another name for Neopentyl glycol diheptanoate is Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol.
What is the EINECS number for Neopentyl glycol diheptanoate?
The EINECS number for Neopentyl glycol diheptanoate is 272-469-1.
What is the EPA Substance Registry System name for Neopentyl glycol diheptanoate?
The EPA Substance Registry System name for Neopentyl glycol diheptanoate is Neopentyl glycol heptanoate.
What are some properties of Neopentyl glycol diheptanoate?
Some properties of Neopentyl glycol diheptanoate include being a skin-conditioning agent, viscosity increasing agent, and emollient. Additionally, it has a density of 0.92 at 20℃.