Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0307 |
| Product Name | N,N-Bis(2-Hydroxyethyl)-p-Phenylenediamine Sulfate |
| CAS | 54381-16-7 |
| Structure |  |
| Synonyms | 2,2'-((4-Aminophenyl)imino)bisethanolsulfatehydrate |
| IUPAC Name | 2-[4-amino-N-(2-hydroxyethyl)anilino]ethanol;sulfuric acid |
| Molecular Weight | 294.33 g/mol |
| Molecular Formula | C10H18N2O6S |
| InChI | InChI=1S/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4) |
| InChI Key | KMCFMEHSEWDYKG-UHFFFAOYSA-N |
| Boiling Point | 125 °C |
| Melting Point | 168-171 °C |
| Purity | 0.98 |
| Density | 1.49 g/mL |
| Appearance | White to Off-White solid |
| Isomeric SMILES | C1=CC(=CC=C1N)N(CCO)CCO.OS(=O)(=O)O |
What is the chemical formula of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The chemical formula is C10H18N2O6S.
What is the melting point of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The melting point is 168-171°C.
What is the boiling point of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The boiling point is 125°C at 101 325 Pa.
What is the color of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The color is white to off-white.
What is the water solubility of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The water solubility is 178g/L at 20°C.
What are some synonyms for N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
Some synonyms include JAROCOL BHP, 2,2'-((4-aminophenyl)imino)bisethanolsulfate, and 4-Amino-N,N-di(beta-hydroxyethyl)aniline sulfate.
What are the safety hazard codes for N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
The hazard code is T.
What are some of the uses of N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate?
It is used in hair dye and has cosmetic applications.
Is N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate flammable?
No, it is non-flammable.
How should N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulphate be stored?
It should be stored in a dark place, sealed in dry, at room temperature.
If you have any questions, please contact us. You will get a satisfactory answer.
