Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0002 |
| Product Name | N-Hydroxysuccinimide |
| CAS | 6066-82-6 |
| Structure |  |
| Synonyms | 1-Hydroxy-5-pyrrolidinedione |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione |
| Molecular Weight | 115.09 g/mol |
| Molecular Formula | C4H5NO3 |
| InChI | InChI=1S/C4H5NO3/c6-3-1-2-4(7)5(3)8/h8H,1-2H2 |
| InChI Key | NQTADLQHYWFPDB-UHFFFAOYSA-N |
| Boiling Point | 215.5 °C |
| Melting Point | 95-98 °C |
| Purity | 0.98 |
| Density | 1.48 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.025 |
| Isomeric SMILES | C1CC(=O)N(C1=O)O |
| pKa | 7.81±0.20 |
What is the chemical formula of N-Hydroxysuccinimide?
The chemical formula of N-Hydroxysuccinimide is C4H5NO3.
What is the molecular weight of N-Hydroxysuccinimide?
The molecular weight of N-Hydroxysuccinimide is 115.09.
How is N-Hydroxysuccinimide commonly used in cosmetics?
N-Hydroxysuccinimide is used in cosmetics as an ester to soften and condition skin, often seen in eye creams to eliminate under eye circles.
What is the role of N-Hydroxysuccinimide in peptide coupling reactions?
N-Hydroxysuccinimide assists carbodiimide-mediated peptide coupling by forming an active ester intermediate.
How is N-Hydroxysuccinimide synthesized?
N-Hydroxysuccinimide can be synthesized by heating succinic anhydride with hydroxylamine or hydroxylamine hydrochloride.
What are some of the chemical properties of N-Hydroxysuccinimide?
N-Hydroxysuccinimide is a clear yellow-brown to brown liquid or solid with a melting point of 95-98°C and a pH of 5-7.
What are some common uses of N-Hydroxysuccinimide in laboratory settings?
N-Hydroxysuccinimide is used as a reagent for the preparation of active esters of amino acids and in improved amidations in the carbodiimide method.
How can N-Hydroxysuccinimide be purified?
N-Hydroxysuccinimide can be recrystallized from EtOH/ethyl acetate for purification.
What safety information should be considered when handling N-Hydroxysuccinimide?
N-Hydroxysuccinimide is considered an irritant and should be handled with appropriate safety measures.
How does N-Hydroxysuccinimide contribute to the formation of stable amide bonds in peptide coupling?
N-Hydroxysuccinimide forms an active ester intermediate that reacts with primary amines to form stable amide bonds in peptide coupling reactions.
If you have any questions, please contact us. You will get a satisfactory answer.
