Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-OT-0002 |
Product Name | N-Hydroxysuccinimide |
CAS | 6066-82-6 |
Structure | ![]() |
Synonyms | 1-Hydroxy-5-pyrrolidinedione |
IUPAC Name | 1-hydroxypyrrolidine-2,5-dione |
Molecular Weight | 115.09 g/mol |
Molecular Formula | C4H5NO3 |
InChI | InChI=1S/C4H5NO3/c6-3-1-2-4(7)5(3)8/h8H,1-2H2 |
InChI Key | NQTADLQHYWFPDB-UHFFFAOYSA-N |
Boiling Point | 215.5 °C |
Melting Point | 95-98 °C |
Purity | 0.98 |
Density | 1.48 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.025 |
Isomeric SMILES | C1CC(=O)N(C1=O)O |
pKa | 7.81±0.20 |
What is the chemical formula of N-Hydroxysuccinimide?
The chemical formula of N-Hydroxysuccinimide is C4H5NO3.
What is the molecular weight of N-Hydroxysuccinimide?
The molecular weight of N-Hydroxysuccinimide is 115.09.
How is N-Hydroxysuccinimide commonly used in cosmetics?
N-Hydroxysuccinimide is used in cosmetics as an ester to soften and condition skin, often seen in eye creams to eliminate under eye circles.
What is the role of N-Hydroxysuccinimide in peptide coupling reactions?
N-Hydroxysuccinimide assists carbodiimide-mediated peptide coupling by forming an active ester intermediate.
How is N-Hydroxysuccinimide synthesized?
N-Hydroxysuccinimide can be synthesized by heating succinic anhydride with hydroxylamine or hydroxylamine hydrochloride.
What are some of the chemical properties of N-Hydroxysuccinimide?
N-Hydroxysuccinimide is a clear yellow-brown to brown liquid or solid with a melting point of 95-98°C and a pH of 5-7.
What are some common uses of N-Hydroxysuccinimide in laboratory settings?
N-Hydroxysuccinimide is used as a reagent for the preparation of active esters of amino acids and in improved amidations in the carbodiimide method.
How can N-Hydroxysuccinimide be purified?
N-Hydroxysuccinimide can be recrystallized from EtOH/ethyl acetate for purification.
What safety information should be considered when handling N-Hydroxysuccinimide?
N-Hydroxysuccinimide is considered an irritant and should be handled with appropriate safety measures.
How does N-Hydroxysuccinimide contribute to the formation of stable amide bonds in peptide coupling?
N-Hydroxysuccinimide forms an active ester intermediate that reacts with primary amines to form stable amide bonds in peptide coupling reactions.