Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0144 |
| Product Name | Microcrystalline Cellulose |
| CAS | 9004-34-6 |
| Structure |  |
| Synonyms | Cellulose, microcrystalline |
| Description | Microcrystalline cellulose is a highly refined, purified form of cellulose that is processed from various plant sources, including wood pulp and cotton fibers. It is a white, odorless, tasteless powder with a uniform particle size and crystalline structure. It is also found in some personal care products, such as toothpaste and cosmetics, as a thickener and stabilizer. |
| IUPAC Name | (6S)-2-(hydroxymethyl)-6-[(3S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Molecular Weight | 342.3 g/mol |
| Molecular Formula | (C12H20O10)n |
| Canonical SMILES | C(C1[C@H](C(C(C(O1)O)O)O)O[C@H]2C(C(C(C(O2)CO)O)O)O)O |
| InChI | GUBGYTABKSRVRQ-WFVLMXAXSA-N |
| InChI Key | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 |
| Boiling Point | Decomposes (NIOSH, 2016);Decomposes;Decomposes |
| Melting Point | 76-78 °C |
| Flash Point | 164 °C |
| Density | 1.5 g/mL |
| Solubility | Insoluble (NIOSH, 2016);Insoluble in water, ethanol, ether and dilute mineral acids. Slightly soluble in sodium hydroxide solution;Insoluble |
| Appearance | fine, white, odorless, and tasteless powder |
| Application | 1. Used as an excipient in the pharmaceutical industry to bind, dilute, or lubricate solid dosage forms such as tablets, capsules, and powders. 2. Acts as an emulsifier, stabilizer, and texture improver in food products such as baked goods, cheese, and frozen desserts. 3. Serves as a bulking agent in dietary supplements and functional foods. 4. Provides a smooth texture and improves mouthfeel in personal care products such as toothpaste and body wash. 5. Used as a binder in the production of compressed salt and mineral blocks for livestock. |
| Features And Benefits | 1. Absorbs excess moisture 2. Enhances product texture 3. Acts as a stabilizer 4. Provides thickening properties 5. Improves skin feel and spreadability of products |
| pH | 5-7.5 (100g/l, H2O, 20°C) |
If you have any questions, please contact us. You will get a satisfactory answer.
