Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0144 |
| Product Name | Microcrystalline Cellulose |
| CAS | 9004-34-6 |
| Structure |  |
| Synonyms | Cellulose, microcrystalline |
| Description | Microcrystalline cellulose is a highly refined, purified form of cellulose that is processed from various plant sources, including wood pulp and cotton fibers. It is a white, odorless, tasteless powder with a uniform particle size and crystalline structure. It is also found in some personal care products, such as toothpaste and cosmetics, as a thickener and stabilizer. |
| IUPAC Name | (6S)-2-(hydroxymethyl)-6-[(3S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Molecular Weight | 342.3 g/mol |
| Molecular Formula | (C12H20O10)n |
| Canonical SMILES | C(C1[C@H](C(C(C(O1)O)O)O)O[C@H]2C(C(C(C(O2)CO)O)O)O)O |
| InChI | GUBGYTABKSRVRQ-WFVLMXAXSA-N |
| InChI Key | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/m1/s1 |
| Boiling Point | Decomposes (NIOSH, 2016);Decomposes;Decomposes |
| Melting Point | 76-78 °C |
| Flash Point | 164 °C |
| Density | 1.5 g/mL |
| Solubility | Insoluble (NIOSH, 2016);Insoluble in water, ethanol, ether and dilute mineral acids. Slightly soluble in sodium hydroxide solution;Insoluble |
| Appearance | fine, white, odorless, and tasteless powder |
| Application | 1. Used as an excipient in the pharmaceutical industry to bind, dilute, or lubricate solid dosage forms such as tablets, capsules, and powders. 2. Acts as an emulsifier, stabilizer, and texture improver in food products such as baked goods, cheese, and frozen desserts. 3. Serves as a bulking agent in dietary supplements and functional foods. 4. Provides a smooth texture and improves mouthfeel in personal care products such as toothpaste and body wash. 5. Used as a binder in the production of compressed salt and mineral blocks for livestock. |
| Features And Benefits | 1. Absorbs excess moisture 2. Enhances product texture 3. Acts as a stabilizer 4. Provides thickening properties 5. Improves skin feel and spreadability of products |
| pH | 5-7.5 (100g/l, H2O, 20°C) |
Microcrystalline Cellulose is a refined, colloidal crystalline cellulose obtained from fibrous plants, appearing as a white, odorless, free-flowing powder that is insoluble in water. Noted for its porosity, it can efficiently hold substantial amounts of both aqueous and oily substances while displaying remarkable compressibility. Its distinctive microcrystalline size and shape make it an ideal component for use as an exfoliating scrub. Additionally, it is recommended for improving the texture and application of products such as soaps, as well as pressed and loose powders, thereby enhancing the overall user experience.
What is Microcrystalline Cellulose?
Microcrystalline cellulose is a purified, isolated colloidal crystalline cellulose derived from fibrous plants. It appears as a white, odorless, free-flowing powder that is insoluble in water.
What are the main uses of Microcrystalline Cellulose?
Microcrystalline cellulose is highly valued for its porous structure and exceptional compressibility, making it an ideal carrier for both aqueous and oily products. It is used to enhance the texture and application of soaps, pressed and loose powders, and scrubs. Additionally, its unique microcrystalline size and shape make it suitable as an exfoliating scrub.
Why is Microcrystalline Cellulose preferred in cosmetic formulations?
Due to its excellent compressibility, Microcrystalline cellulose enhances the texture and durability of cosmetic products, particularly in pressed and loose powders. Its ability to absorb and hold a high load of liquids also makes it a versatile ingredient in various formulations. Moreover, its exfoliating properties improve skin texture when used in scrubs.
Is Microcrystalline Cellulose water-soluble?
No, Microcrystalline cellulose is insoluble in water. However, its porous nature allows it to effectively carry both aqueous and oily substances despite this characteristic.
Can Microcrystalline Cellulose be used for skin exfoliation?
Yes, thanks to its unique size and shape, Microcrystalline cellulose functions effectively as an exfoliating scrub, helping to remove dead skin cells and improve skin feel.
What benefits does Microcrystalline Cellulose provide in soap formulations?
In soaps, Microcrystalline cellulose contributes to better lather stability and texture. Its compressibility supports the formation of solid, well-structured soap bars that maintain their shape over time.
What are the physical properties of Microcrystalline Cellulose?
Microcrystalline cellulose is known for being a white, odorless powder that is free-flowing and porous. These physical properties make it ideal for applications that require excellent flowability and material stability.
How does Microcrystalline Cellulose improve the application of powders?
Due to its compressibility, Microcrystalline cellulose provides a smooth, consistent texture to pressed and loose powders, ensuring an even application on the skin with minimal clumping or fallout.
If you have any questions, please contact us. You will get a satisfactory answer.
