Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0206 |
| Product Name | Methylisothiazolinone |
| CAS | 2682-20-4 |
| Structure |  |
| Synonyms | Methylisothiazolinone;3(2H)-Isothiazolone, 2-methyl- |
| IUPAC Name | 2-methyl-1,2-thiazol-3-one |
| Molecular Weight | 115.15 g/mol |
| Molecular Formula | C4H5NOS |
| InChI | InChI=1S/C4H5NOS/c1-5-4(6)2-3-7-5/h2-3H,1H3 |
| InChI Key | BEGLCMHJXHIJLR-UHFFFAOYSA-N |
| Melting Point | 254-256 °C |
| Purity | 95% |
| Density | 1.25 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CN1C(=O)C=CS1 |
What is the chemical name of Methylisothiazolinone?
The chemical name of Methylisothiazolinone is 2-Methyl-4-isothiazolin-3-one.
What is the molecular formula of Methylisothiazolinone?
The molecular formula of Methylisothiazolinone is C4H5NOS.
What is the boiling point of Methylisothiazolinone?
The boiling point of Methylisothiazolinone is approximately 93°C.
What is the water solubility of Methylisothiazolinone?
The water solubility of Methylisothiazolinone is 489g/L at 20℃.
What are the hazard codes associated with Methylisothiazolinone?
The hazard codes associated with Methylisothiazolinone are N, C, and T.
How is Methylisothiazolinone used in industrial settings?
Methylisothiazolinone is used to control slime-forming bacteria, fungi, and algae in various industrial applications such as pulp/paper mills, cooling water systems, and more.
What type of products is Methylisothiazolinone commonly used in?
Methylisothiazolinone is commonly used in rinse-off and leave-on cosmetic products, including shampoo, conditioner, body wash, lotion, and more.
What is the common concentration of Methylisothiazolinone allowed in cosmetic products?
The common maximum concentration of Methylisothiazolinone allowed in cosmetic products is 100 ppm.
What is the safety conclusion regarding the neurotoxicity of Methylisothiazolinone?
The Cosmetic Ingredient Review Expert Panel concluded that Methylisothiazolinone would not be neurotoxic as used in cosmetics.
What is the preparation method for 2-Methyl-4-isothiazolin-3-one?
2-Methyl-4-isothiazolin-3-one is prepared by the cyclization of cis-N-methyl-3-thiocyanoacrylamide.
If you have any questions, please contact us. You will get a satisfactory answer.
