Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0075 |
| Product Name | Methionine |
| CAS | 59-51-8 |
| Structure |  |
| Synonyms | DL-Methionine |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid |
| Molecular Weight | 149.21 g/mol |
| Molecular Formula | C5H11NO2S |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChI Key | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| Boiling Point | 306.9±37.0 °C |
| Melting Point | 284 °C |
| Purity | 0.98 |
| Density | 1.34 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0091 |
| Highest Usage In Rinsing Products | 0.01 |
| Isomeric SMILES | CSCCC(C(=O)O)N |
| pKa | 2.13 |
If you have any questions, please contact us. You will get a satisfactory answer.
