Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1250 |
Product Name | Menthyl PCA |
CAS | 64519-44-4 |
Structure | ![]() |
Synonyms | Menthyl PCA;Menthyl pyrrolidone carboxylate, (-), L-;FEMA No. 4155 |
IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-5-oxopyrrolidine-2-carboxylate |
Molecular Weight | 267.36 g/mol |
Molecular Formula | C15H25NO3 |
InChI | InChI=1S/C15H25NO3/c1-9(2)11-5-4-10(3)8-13(11)19-15(18)12-6-7-14(17)16-12/h9-13H,4-8H2,1-3H3,(H,16,17)/t10-,11+,12+,13-/m1/s1 |
InChI Key | SLHPMAOXNSLXEH-MROQNXINSA-N |
Purity | 95% |
Density | 1.06 g/mL |
Solubility | Soluble in water |
Appearance | Liquid |
Highest Usage In Residency Products | 0.02 |
Isomeric SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@@H]2CCC(=O)N2)C(C)C |
What is the chemical name of the compound with the CAS number 64519-44-4?
The chemical name is (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate.
What are some synonyms for (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate?
Some synonyms include MENTHYL PCA, L-Proline, 5-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, and QUESTICELIQUID.
What is the molecular formula of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate?
The molecular formula is C15H25NO3.
What is the molecular weight of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate?
The molecular weight is 267.36.
What is the density of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate at 20℃?
The density is 1.064.
What is the water solubility of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate at 20℃?
The water solubility is 622.5mg/L.
What is the logP value of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate at 22℃?
The logP value is 3.13.
What is the main usage of (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate?
It is used in formulations for preventing and treating skin irritation.
Is (1R,2S,5R)-5-Methyl-2-isopropylcyclohexyl 5-oxo-L-prolinate classified as flammable or explosive?
No, it is not classified as flammable or explosive.
What is the EPA Substance Registry System name for (-)-Menthyl (-)-2-pyrrolidone-5-carboxylate?
The EPA Substance Registry System name is (-)-Menthyl (-)-2-pyrrolidone-5-carboxylate.