Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Matrine

Online Inquiry
Catalog Number CI-GU-0040
Product Name Matrine
CAS 519-02-8
Structure
Synonyms Matridin-15-one
IUPAC Name (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one
Molecular Weight 248.36 g/mol
Molecular Formula C15H24N2O
InChI InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-/m0/s1
InChI Key ZSBXGIUJOOQZMP-JLNYLFASSA-N
Melting Point 77 °C
Purity 90%
Density 1.19 g/mL
Appearance Solid
Highest Usage In Residency Products 0.013
Highest Usage In Rinsing Products 0.021
Isomeric SMILES C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@@H](CCC4)CN2C(=O)C1
Custom Q&A

What is Matrine and where is it derived from?

Matrine is a natural alkaloid extracted from the roots of the Sophora flavescens plant. It is known for its diverse biological activities, including anti-inflammatory, anti-cancer, and anti-viral properties.

What therapeutic applications does Matrine have?

Matrine has been explored for its potential in treating various conditions such as hepatitis, cancer, and cardiovascular diseases. Its versatility in therapeutic applications makes it a valuable asset in pharmaceutical research and development.

How is Matrine used in agriculture?

In agriculture, Matrine is recognized as an effective natural pesticide. It provides an eco-friendly alternative to synthetic chemicals, inhibiting the growth of certain pests while being less harmful to beneficial insects, thus supporting sustainable farming practices.

What makes Matrine a suitable candidate for pharmaceutical development?

Matrine has demonstrated potential in treating a range of diseases, including cancer and liver disorders. Its ability to target these conditions makes it a significant compound in drug formulation and pharmaceutical research.

Can Matrine play a role in skin care products?

Yes, due to its skin-soothing properties, Matrine is incorporated into cosmetic formulations. It offers natural benefits for sensitive skin types and is used in skincare products to enhance skin health.

What potential does Matrine have in anti-inflammatory research?

Studies have indicated that Matrine possesses anti-inflammatory properties, which could be beneficial in developing treatments for chronic inflammatory conditions, supporting its role in anti-inflammatory research.

How is Matrine involved in neuroprotective studies?

Matrine is being studied for its potential to protect nerve cells, making it a promising candidate in the development of therapies targeting neurodegenerative diseases. Researchers are exploring its neuroprotective benefits in various studies.

Online Inquiry
Verification code