Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0063 |
| Product Name | Malic Acid |
| CAS | 97-67-6 |
| Structure |  |
| Synonyms | L-Malic acid |
| IUPAC Name | (2S)-2-hydroxybutanedioic acid |
| Molecular Weight | 134.09 g/mol |
| Molecular Formula | C4H6O5 |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChI Key | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Boiling Point | 167 °C |
| Melting Point | 101-103 °C |
| Purity | 0.98 |
| Density | 1.6 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C([C@@H](C(=O)O)O)C(=O)O |
Malic acid, a dicarboxylic acid naturally found in various fruits, is widely used in both the food and personal care industries. Initially isolated from apple juice in 1785, it imparts a tart flavor to foods and beverages, but its applications extend far beyond culinary uses. Within the human body, malic acid plays a critical role in the Krebs cycle, assisting in energy production, which is particularly beneficial during exercise and other demanding physical activities. Additionally, it is used therapeutically to manage symptoms associated with fibromyalgia and Chronic Fatigue Syndrome, particularly in middle-aged women. In personal care products, malic acid contributes to skin rejuvenation by exfoliating dead skin cells and promoting the turnover of new cells, thereby addressing sun damage and reducing surface-level bacteria, including Listeria. This multifaceted acid also aids in detoxification processes, protecting the body from a range of potential disorders.
What is Malic Acid and where is it commonly found?
Malic Acid is a dicarboxylic acid that naturally occurs in many fruits and tart or sour foods. It is also one of the alpha-hydroxy acids (AHAs) and was first isolated from apple juice in 1785. Apart from being naturally manufactured in the body during the Krebs cycle, it can be obtained from the foods we consume.
What are the health benefits associated with Malic Acid?
Malic Acid has several health benefits. It can alleviate symptoms of fibromyalgia, particularly in middle-aged women, and it supports the body's high energy demands during exercise and strenuous activities. It is also beneficial for individuals suffering from Chronic Fatigue Syndrome due to its energy-boosting properties.
How does Malic Acid contribute to detoxification in the body?
Malic Acid aids in reducing toxicity within the body, which can help prevent various disorders. By breaking down toxins, it supports liver function and overall metabolic processes, promoting better health.
In what commercial products is Malic Acid commonly used?
Commercially, Malic Acid is widely used in numerous food items to impart a sour taste. It is also incorporated in personal care and medical products due to its beneficial properties, including its role in skin care formulations.
How does Malic Acid benefit the skin?
Malic Acid interrupts the attachment of corneocytes in the epidermis, facilitating exfoliation of dull, old cells and promoting skin renewal. It enhances the skin's renewal rate by inducing apoptosis of sun-damaged cells. Additionally, it possesses antibacterial properties, providing protection against certain bacterial infections such as cutaneous listeriosis.
If you have any questions, please contact us. You will get a satisfactory answer.
