Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0143 |
| Product Name | Lactose |
| CAS | 63-42-3 |
| Structure |  |
| Synonyms | Galβ1, 4Glc |
| Description | Lactose is a type of sugar found in milk and milk products. It is composed of two simple sugar molecules, glucose and galactose, joined together by a chemical bond. Lactose is broken down in the body by the enzyme lactase, which is produced in the small intestine. |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Molecular Weight | 342.3 g/mol |
| Molecular Formula | C12H22O11 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| InChI Key | GUBGYTABKSRVRQ-DCSYEGIMSA-N |
| Boiling Point | 397.76 °C |
| Melting Point | 222.8 °C |
| Flash Point | 357.8°C |
| Purity | 98% |
| Density | 1.53 g/mL |
| Solubility | Insoluble in ether and chloroform, very slightly soluble in alcohol |
| Appearance | white, odorless, and crystalline powder |
| Application | 1. Food industry: Lactose is widely used as a sweetener and bulking agent in the production of baked goods, confectionery, and dairy products. 2. Pharmaceutical industry: Lactose is a common excipient in the manufacture of tablets and capsules as it helps to bind drugs together and provide them with their desired physical properties. 3. Medical industry: Lactose is used in diagnostic tests for lactose intolerance and the determination of small intestinal transit time. 4. Agriculture: Lactose is used as a nutritional supplement in animal feed to increase milk production and improve weight gain in young animals. 5. Chemical industry: Lactose is used as a raw material in the production of lactic acid, which is used in a range of industrial applications, including the production of biodegradable plastics. |
| Features And Benefits | 1. Lactose serves as a natural moisturizer. 2. It helps in improving the texture and appearance of the skin. 3. It can also assist in exfoliation and skin renewal. 4. Lactose is known for its ability to provide a soothing effect on the skin. 5. It aids in maintaining the natural pH balance of the skin. 6. Lactose can help in skin lightening and reducing hyperpigmentation. |
| Isomeric SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
| Refractive Index | 1.652 |
| Topological Polar Surface Area | 190 Ų |
If you have any questions, please contact us. You will get a satisfactory answer.
