Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0083 |
| Product Name | Lactobionic acid |
| CAS | 96-82-2 |
| Structure |  |
| Synonyms | 4-O-β-D-Galactopyranosyl-D-gluconic acid |
| IUPAC Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoic acid |
| Molecular Weight | 358.3 g/mol |
| Molecular Formula | C12H22O12 |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5+,6+,7-,8-,9-,10-,12+/m1/s1 |
| InChI Key | JYTUSYBCFIZPBE-AMTLMPIISA-N |
| Boiling Point | 410.75 °C |
| Melting Point | 113-118 °C |
| Density | 1.47 g/mL |
| Appearance | White to off-white powder |
| Isomeric SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C(=O)O)O)O)O)O)O)O |
Lactobionic acid, a polyhydroxy acid derived from the oxidation of lactose, serves numerous beneficial roles in the skincare industry. Renowned for its antioxidant properties and mild exfoliating capabilities, lactobionic acid gently removes old and dead skin cells, revealing a fresher and more radiant complexion. Its larger molecular size in comparison to other hydroxy acids allows it to target only the superficial skin layer, minimizing the risk of irritation often associated with chemical peels. Additionally, it forms a unique gel film that is oxygen-permeable and moisture-impermeable, providing enhanced moisturization and acting as a humectant due to its multiple hydroxy groups. This makes it particularly effective in promoting the production of extracellular matrix components and accelerating skin renewal. Furthermore, lactobionic acid's ability to maintain skin pH balance and its non-intrusive nature make it a valuable ingredient for high-end skincare formulations.
What is Lactobionic Acid and how is it produced?
Lactobionic acid is a polyhydroxy acid (PHA) that is derived from lactose, which is a disaccharide composed of glucose and galactose units. The unique production process involves the oxidation of the glucose unit into gluconic acid.
How is Lactobionic Acid used in skincare products?
In skincare applications, Lactobionic acid forms a gel film that is oxygen-permeable and moisture impermeable. This film is water soluble and offers excellent anti-aging and high moisturizing properties. Additionally, Lactobionic acid acts as a mild keratolytic agent, exfoliating dead skin cells and promoting a fresh, radiant skin appearance. Its larger molecular size limits its penetration to the skin's superficial layers, reducing the risk of irritation compared to other hydroxy acids.
What are the benefits of using Lactobionic Acid in skincare?
Lactobionic acid offers several benefits, including strong moisturizing and humectant properties due to its multiple hydroxy groups, excellent antioxidant and chelating abilities, and enhancement of extracellular matrix (ECM) component production. These properties contribute to increased skin renewal rates, making it an effective ingredient in anti-aging skincare preparations.
Can Lactobionic Acid be used as a food preservative?
Yes, Lactobionic acid is used as a high-end food preservative. It is valued for its ability to maintain the flavor, color, and taste of foods while providing excellent antioxidant properties, making it an ideal choice in the food industry.
How does the exfoliation capability of Lactobionic Acid compare with other hydroxy acids?
Lactobionic acid boasts a gentle exfoliation capability, acting as a mild keratolytic agent. Similar to other hydroxy acids used for chemical peels, it eliminates dull and dead keratinocytes. However, because of its larger molecular size, it penetrates only the superficial layers of the skin, which minimizes potential irritation and adverse effects associated with deeper penetration by other smaller hydroxy acids.
Does Lactobionic Acid have any pH-adjusting properties?
Yes, in addition to its antioxidant and chelating abilities, Lactobionic acid exhibits effective pH-adjusting properties. This makes it a versatile ingredient in various skincare formulations, helping to stabilize product pH levels and enhance overall efficacy.
If you have any questions, please contact us. You will get a satisfactory answer.
