Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0046 |
| Product Name | L-glutatione |
| CAS | 70-18-8 |
| Structure |  |
| Synonyms | Glutathione (skin lightening peptide) |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Molecular Weight | 307.32 g/mol |
| Molecular Formula | C10H17N3O6S |
| InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Boiling Point | 754.5±60.0 °C |
| Melting Point | 192-195 °C |
| Purity | 0.95 |
| Density | 1.45 g/mL |
| Appearance | White powder |
| Isomeric SMILES | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |
L-glutathione plays a pivotal role in cellular protection across animal and plant tissues due to its dual function as an antioxidant and as a conjunction agent for the detoxification of various metabolites. Synthesized primarily in the liver, as well as in yeasts and plant leaves, L-glutathione exists in two forms: the biologically active reduced form, known as GSH, and the oxidized form. With the essential thiol (-SH) group, GSH actively participates in enzymatic processes that facilitate its conversion between these two states, driven by the presence of reducing or oxidizing agents. This conversion enables L-glutathione to effectively neutralize hydrogen peroxide and oxygenated radicals, which can otherwise cause significant damage to lipids, proteins, enzymes, and cellular DNA, thereby maintaining cellular integrity and function.
What is L-Glutathione, and what role does it play in the body?
L-Glutathione is a tripeptide, consisting of glutamic acid, cysteine, and glycine. It is primarily synthesized in the liver and is found throughout animal and plant tissues. Its primary function is to protect cells by serving as an antioxidant and a conjugating agent that aids in the elimination of metabolites from the body.
How does L-Glutathione function as an antioxidant?
L-Glutathione protects cells by neutralizing harmful substances like hydrogen peroxide and oxygen radicals. These substances can damage lipids, proteins, enzymes, and DNA within the cells. By converting these reactive molecules into nonreactive forms, L-Glutathione helps prevent cellular damage.
What is the difference between the oxidized and reduced forms of Glutathione?
Glutathione exists in two forms: oxidized (glutathione disulfide) and reduced (L-Glutathione or GSH). The reduced form, GSH, is the active form that participates in antioxidant activities. Within living organisms, these two forms are interconverted by specific enzymes and reactions involving reducing or oxidizing agents.
Why is the reduced form of L-Glutathione important?
The reduced form, GSH, is crucial because it contains the -SH thiol group, which is responsible for the molecule's reducing activity. This form is biologically active and works with endogenous enzymes like glutathione peroxidase to maintain the oxido-reduction balance needed for cellular protection and detoxification.
If you have any questions, please contact us. You will get a satisfactory answer.
