Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0071 |
| Product Name | Kaempferol |
| CAS | 520-18-3 |
| Structure |  |
| Synonyms | 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4h-1-benzopyran-4-on |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Molecular Weight | 286.23 g/mol |
| Molecular Formula | C15H10O6 |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,16-18,20H |
| InChI Key | IYRMWMYZSQPJKC-UHFFFAOYSA-N |
| Boiling Point | 348.5 °C |
| Melting Point | 276 °C |
| Purity | 95% |
| Density | 1.29 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0005 |
| Isomeric SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| pKa | 6.34±0.40 |
If you have any questions, please contact us. You will get a satisfactory answer.
