Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-EO-0034 |
| Product Name | Jasmine oil |
| CAS | 8022-96-6 |
| Synonyms | Jasmine flower oil |
| IUPAC Name | 1-but-2-enyl-2-methylcyclopentene |
| Molecular Weight | 136.23 g/mol |
| Molecular Formula | C10H16 |
| InChI | InChI=1S/C10H16/c1-3-4-7-10-8-5-6-9(10)2/h3-4H,5-8H2,1-2H3 |
| InChI Key | QUQOZOBHIUEDSV-UHFFFAOYSA-N |
| Purity | 0.98 |
| Appearance | Liquid |
| Isomeric SMILES | CC=CCC1=C(CCC1)C |
What are the synonyms of Jasmine oil?
ConcreteJasminItalian; Concretejasminturc; HyperabsoluteJasmine; Jasmin; Jasminabsolute; Jasmincomores; Jasmineconcrete; Jasmineoil, French
What is the CAS number of Jasmine oil?
8022-96-6
What is the molecular formula of Jasmine oil?
C10H16
What are some chemical properties of Jasmine oil?
Density, refractive index, FEMA number, flash point, odor, CAS DataBase Reference
What are the hazard codes associated with Jasmine oil?
Xn
How is Jasmine oil obtained?
By distilling the absolute essence with superheated steam at reduced pressure and at a specific temperature based on the original concrete
What are some chemical properties of Jasmine oil extract?
Color, ester number, acid number, main volatile components
What are the main uses of Jasmine oil?
Fragrance, moisturizing, soothing, skin-conditioning, and healing properties
How is Jasmine oil typically obtained from the plant's flowers?
Through enfleurage, a time-consuming and costly process involving sprinkling flowers over oiled glass trays
Are there any safety concerns associated with Jasmine oil?
Jasmine oil may cause allergic reactions such as swelling, which can last several days. It has low toxicity by ingestion and emits irritating vapors when heated to decomposition.
If you have any questions, please contact us. You will get a satisfactory answer.
