Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0098 |
| Product Name | Isoquercitrin |
| CAS | 21637-25-2 |
| Structure |  |
| Synonyms | 3,3',4',5,7-Pentahydroxyflavone 3-β-glucoside |
| IUPAC Name | 3-[(2S,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Molecular Weight | 464.4 g/mol |
| Molecular Formula | C21H20O12 |
| InChI | InChI=1S/C21H20O12/c22-6-12(27)19-16(29)17(30)21(32-19)33-20-15(28)14-11(26)4-8(23)5-13(14)31-18(20)7-1-2-9(24)10(25)3-7/h1-5,12,16-17,19,21-27,29-30H,6H2/t12-,16-,17-,19-,21+/m1/s1 |
| InChI Key | OPJZLUXFQFQYAI-GNPVFZCLSA-N |
| Boiling Point | 916.3±65.0 °C |
| Melting Point | 225-227 °C |
| Purity | 95% |
| Density | 1.87 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0005 |
| Isomeric SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@H](O4)[C@@H](CO)O)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
