Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1297 |
| Product Name | Hydroxyphenyl Propamidobenzoic Acid |
| CAS | 697235-49-7 |
| Synonyms | 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid |
| IUPAC Name | 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
| Molecular Weight | 285.29 g/mol |
| Molecular Formula | C16H15NO4 |
| InChI | InChI=1S/C16H15NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-6,8-9,18H,7,10H2,(H,17,19)(H,20,21) |
| InChI Key | DLFOKZQWYFNKCL-UHFFFAOYSA-N |
| Boiling Point | 590.0±40.0 °C |
| Purity | 95% |
| Density | 1.35 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)CCC2=CC=C(C=C2)O |
| pKa | 3.47±0.10 |
What is the chemical formula for 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid?
The chemical formula is C16H15NO4.
What is the molecular weight of hydroxyphenyl propamidobenzoic acid?
The molecular weight is 285.29 g/mol.
What is the water solubility of 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid at 20°C?
The water solubility is 86.5 mg/L at 20°C.
What is the main property of hydroxyphenyl propamidobenzoic acid?
It is an off-white powder.
What is the predicted boiling point of 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid?
The predicted boiling point is 590.0±40.0 °C.
What is the pka value of hydroxyphenyl propamidobenzoic acid?
The pka value is 3.47±0.10.
What are some synonyms for 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid?
Some synonyms include Dihydroavenanthramide D, Dihydroavenanthramide, and NanoCalmin 5%.
How is hydroxyphenyl propamidobenzoic acid used in skincare products?
It is used as a skin soothing agent with anti-irritant benefits to reduce redness, inflammation, and itch, and it has antioxidant efficacy.
What is the safety study conducted on hydroxyphenyl propamidobenzoic acid in animals?
The study investigated the substance's ability to regulate tissue oxidation and antioxidant balance in mice and its effect on oxidation induced by exercise in the internal organs of mice.
Is 2-(3-(4-hydroxyphenyl)propanamido)benzoic acid flammable?
No, it is non-flammable.
If you have any questions, please contact us. You will get a satisfactory answer.
