Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0214 |
| Product Name | 4-Hydroxybenzoic Acid |
| CAS | 99-96-7 |
| Structure |  |
| Synonyms | Benzoicacid,4-hydroxy |
| IUPAC Name | 4-hydroxybenzoic acid |
| Molecular Weight | 138.12 g/mol |
| Molecular Formula | C7H6O3 |
| InChI | InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10) |
| InChI Key | FJKROLUGYXJWQN-UHFFFAOYSA-N |
| Melting Point | 213-217 °C |
| Purity | 0.95 |
| Density | 1.46 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1C(=O)O)O |
| pKa | 4.48 |
What is the chemical formula of 4-Hydroxybenzoic acid?
The chemical formula of 4-Hydroxybenzoic acid is C7H6O3.
What is the molecular weight of 4-Hydroxybenzoic acid?
The molecular weight of 4-Hydroxybenzoic acid is 138.12.
Where can 4-Hydroxybenzoic acid be found naturally?
4-Hydroxybenzoic acid can be found naturally in fruit peels, leaves, coconut, and green tea infusions.
What is the main commercial application of 4-Hydroxybenzoic acid and its esters?
The main commercial application of 4-Hydroxybenzoic acid and its esters is as preservatives in cosmetics and some ophthalmic solutions.
How is 4-Hydroxybenzoic acid prepared?
4-Hydroxybenzoic acid can be prepared from p-bromophenol, p-hydroxybenzaldehyde, or the saponification of methyl salicylate.
What are some uses of 4-Hydroxybenzoic acid in organic synthesis?
4-Hydroxybenzoic acid is used as an intermediate for dyes, antiseptics, and active pharmaceutical ingredients in organic synthesis.
What is the aroma threshold value of 4-Hydroxybenzoic acid in water?
The aroma of 4-Hydroxybenzoic acid can be detected at 5 ppm in water.
What is the purification method recommended for 4-Hydroxybenzoic acid?
4-Hydroxybenzoic acid can be purified by crystallization from water.
What is the boiling point of 4-Hydroxybenzoic acid?
The boiling point of 4-Hydroxybenzoic acid is approximately 213.5°C.
In what form does 4-Hydroxybenzoic acid exist at room temperature?
4-Hydroxybenzoic acid exists as a white to ivory crystalline powder at room temperature.
If you have any questions, please contact us. You will get a satisfactory answer.
