Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1243 |
| Product Name | Hexyl Nicotinate |
| CAS | 23597-82-2 |
| Structure |  |
| Synonyms | 3-Pyridinecarboxylic acid, hexyl ester;Nicotinic acid, hexyl ester |
| IUPAC Name | hexyl pyridine-3-carboxylate |
| Molecular Weight | 207.27 g/mol |
| Molecular Formula | C12H17NO2 |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-5-9-15-12(14)11-7-6-8-13-10-11/h6-8,10H,2-5,9H2,1H3 |
| InChI Key | RVYGVBZGSFLJKH-UHFFFAOYSA-N |
| Boiling Point | 140 °C |
| Purity | 95% |
| Density | 1.02 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0046 |
| Isomeric SMILES | CCCCCCOC(=O)C1=CN=CC=C1 |
| pKa | 3.21±0.10 |
What is the chemical formula of Hexyl nicotinate?
The chemical formula of Hexyl Nicotinate is C12H17NO2.
What is the molecular weight of Hexyl nicotinate?
The molecular weight of Hexyl Nicotinate is 207.27.
What is the boiling point of Hexyl nicotinate?
The boiling point of Hexyl Nicotinate is 140°C.
What is the density of Hexyl nicotinate?
The density of Hexyl Nicotinate is 1.02 g/cm3.
How soluble is Hexyl nicotinate in water?
Hexyl Nicotinate is soluble in water at a rate of 0.17g/L at 32ºC.
What is the application of Hexyl nicotinate in cosmetics?
Hexyl Nicotinate is used as a cosmetic ingredient in applications such as sun tanning lotions, creams, slimming gels, and creams.
How does Hexyl nicotinate benefit the skin?
Hexyl Nicotinate enhances blood circulation in the skin, leading to improved supply of oxygen, nutrients, and moisture to skin cells.
How is Hexyl nicotinate used in the treatment of muscle, joint, and ligament pain?
Hexyl Nicotinate can be used topically in creams, baths, and emulsions for the treatment of muscle, joint, and ligament pain.
Why is Hexyl nicotinate preferred over Niacin in cosmetic formulations?
Hexyl Nicotinate is preferred over Niacin due to its better penetrating power and rubefacient properties.
What is the role of Hexyl nicotinate in thermo-slimming compositions?
Hexyl Nicotinate can produce pronounced thermo-slimming compositions by enhancing blood circulation in the skin and improving the skin's metabolism.
If you have any questions, please contact us. You will get a satisfactory answer.
