Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0067 |
| Product Name | Hexanoyl dipeptide-3 norleucine acetate |
| CAS | 860627-90-3 |
| Structure |  |
| Synonyms | (2S)-2-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(hexanoylamino)pentanoyl]amino]propanoyl]amino]hexanamide |
| IUPAC Name | acetic acid;(2S)-2-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(hexanoylamino)pentanoyl]amino]propanoyl]amino]hexanamide |
| Molecular Weight | 515.66 g/mol |
| Molecular Formula | C23H45N7O6 |
| InChI | InChI=1S/C21H41N7O4.C2H4O2/c1-4-6-8-12-17(29)27-16(11-9-13-25-21(23)24)20(32)26-14(3)19(31)28-15(18(22)30)10-7-5-2;1-2(3)4/h14-16H,4-13H2,1-3H3,(H2,22,30)(H,26,32)(H,27,29)(H,28,31)(H4,23,24,25);1H3,(H,3,4)/t14-,15-,16-;/m0./s1 |
| InChI Key | VZFVSUWDAQRRET-NLQWVURJSA-N |
| Purity | 0.95 |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | CCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCC)C(=O)N.CC(=O)O |
| Safety | No heavy metals, no skin and eye irritation |
What are some potential benefits of using products containing hexanoyl dipeptide-3 norleucine acetate?
Some potential benefits include improved skin texture and appearance.
How do skincare products containing hexanoyl dipeptide-3 norleucine acetate compare to traditional exfoliants?
Skincare products containing this ingredient may provide gentler exfoliation compared to traditional exfoliants.
What is the CAS number of hexanoyl dipeptide-3 norleucine acetate?
The CAS number is 860627-90-3.
What is the molecular formula of hexanoyl dipeptide-3 norleucine acetate?
The molecular formula is C23H45N7O6.
What is the molecular weight of hexanoyl dipeptide-3 norleucine acetate?
The molecular weight is 515.66.
How does hexanoyl dipeptide-3 norleucine acetate work on the skin?
It acts as an exfoliant and can help improve the overall condition of the skin.
What is the main function of hexanoyl dipeptide-3 norleucine acetate in skincare products?
Its main function is to improve the overall condition of the skin.
How is hexanoyl dipeptide-3 norleucine acetate commonly used in beauty products?
It is used as an exfoliant in skincare products.
If you have any questions, please contact us. You will get a satisfactory answer.
