Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0167 |
| Product Name | Glycol Salicylate |
| CAS | 87-28-5 |
| Structure |  |
| Synonyms | 2-Hydroxybenzoic acid, 2-hydroxyethyl ester;2-Hydroxyethyl salicylate;Benzoic acid, 2-hydroxy-, 2-hydroxyethyl ester;Salicylic acid, 2-hydroxyethyl ester |
| IUPAC Name | 2-hydroxyethyl 2-hydroxybenzoate |
| Molecular Weight | 182.17 g/mol |
| Molecular Formula | C9H10O4 |
| InChI | InChI=1S/C9H10O4/c10-5-6-13-9(12)7-3-1-2-4-8(7)11/h1-4,10-11H,5-6H2 |
| InChI Key | LVYLCBNXHHHPSB-UHFFFAOYSA-N |
| Boiling Point | 166 °C / 13mmHg |
| Melting Point | 25 °C |
| Purity | 95% |
| Density | 1.24 g/mL |
| Appearance | Oily liquid or low melting solid |
| Isomeric SMILES | C1=CC=C(C(=C1)C(=O)OCCO)O |
| pKa | 8.00±0.30 |
What is the chemical name of the compound 2-Hydroxyethyl salicylate?
The chemical name of the compound 2-Hydroxyethyl salicylate is SALICYLIC ACID ETHYLENE GLYCOL ESTER.
What is the CAS number for 2-Hydroxyethyl salicylate?
The CAS number for 2-Hydroxyethyl salicylate is 87-28-5.
What is the molecular formula of 2-Hydroxyethyl salicylate?
The molecular formula of 2-Hydroxyethyl salicylate is C9H10O4.
What is the melting point of 2-Hydroxyethyl salicylate?
The melting point of 2-Hydroxyethyl salicylate is 25°C.
What are the safety hazard codes associated with 2-Hydroxyethyl salicylate?
The safety hazard code associated with 2-Hydroxyethyl salicylate is Xn.
What is the boiling point of 2-Hydroxyethyl salicylate?
The boiling point of 2-Hydroxyethyl salicylate is 166 °C at 13 mm Hg.
What is the color of 2-Hydroxyethyl salicylate?
The color of 2-Hydroxyethyl salicylate is colorless.
What is the specific gravity of 2-Hydroxyethyl salicylate?
The specific gravity of 2-Hydroxyethyl salicylate is 1.244 at 20/4℃.
How is 2-Hydroxyethyl salicylate used in skincare?
2-Hydroxyethyl salicylate is used in skincare to improve the aesthetic appearance of the skin.
What is a common use of 2-Hydroxyethyl salicylate in chemical synthesis?
A common use of 2-Hydroxyethyl salicylate in chemical synthesis is as a building block for various chemical reactions.
If you have any questions, please contact us. You will get a satisfactory answer.
