Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1235 |
| Product Name | Glyceryl Arachidonate |
| CAS | 35474-99-8 |
| Structure |  |
| Synonyms | 1-Arachidonyl monoglyceride;Arachidonic acid, monoester with 1,2,3-propanetriol;Glyceryl arachidonate;Glyceryl monoarachidonate |
| IUPAC Name | 2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Molecular Weight | 378.5 g/mol |
| Molecular Formula | C23H38O4 |
| InChI | InChI=1S/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-21-22(25)20-24/h6-7,9-10,12-13,15-16,22,24-25H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChI Key | DCPCOKIYJYGMDN-DOFZRALJSA-N |
| Boiling Point | 508.5±50.0 °C |
| Melting Point | 81.5 °C |
| Purity | 95% |
| Density | 0.99 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(CO)O |
What is Glyceryl Arachidonate and its primary function in skincare products?
Glyceryl Arachidonate is an ester formed by the reaction of glycerol with arachidonic acid. It primarily functions as an emulsifier and emollient in skincare products, providing moisturizing properties that enhance skin barrier function by reducing transepidermal water loss.
In which types of products is Glyceryl Arachidonate commonly used?
Glyceryl Arachidonate is commonly found in suntan gels, creams, and lotions, where it helps improve the texture and effectiveness of these formulations while offering moisturization.
What is the significance of Glyceryl Arachidonate's chemical structure?
The chemical structure of Glyceryl Arachidonate, as an ester involving arachidonic acid, makes it highly unsaturated and prone to oxidation. This structure allows it to serve as a stabilized reservoir of arachidonic acid, which can be hydrolyzed to release free arachidonic acid that participates in important cellular signaling pathways related to inflammation and immune responses.
How does Glyceryl Arachidonate contribute to the anti-inflammatory potential of skincare products?
Glyceryl Arachidonate may modulate inflammatory pathways when it is hydrolyzed to release arachidonic acid. While its anti-inflammatory potential depends on formulation and concentration, it is believed to play a role in managing skin inflammation when appropriately utilized in skincare products.
Is Glyceryl Arachidonate safe for use in topical applications?
Yes, Glyceryl Arachidonate is generally considered safe for use in topical applications. It has low irritation potential compared to free fatty acids and demonstrates good skin tolerance. However, patch testing is recommended for individuals with sensitive skin to avoid any possible allergic reactions.
How is Glyceryl Arachidonate regulated in the cosmetics industry?
Glyceryl Arachidonate is listed in cosmetic ingredient databases such as the INCI Directory and complies with FDA and EMA guidelines for topical use, provided that purity standards are met. This ensures its safe inclusion in cosmetic products.
If you have any questions, please contact us. You will get a satisfactory answer.
