Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0046 |
Product Name | L-glutatione |
CAS | 70-18-8 |
Structure | |
Synonyms | Glutathione (skin lightening peptide) |
IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
Molecular Weight | 307.32 g/mol |
Molecular Formula | C10H17N3O6S |
InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
Boiling Point | 754.5±60.0 °C |
Melting Point | 192-195 °C |
Purity | 0.95 |
Density | 1.45 g/mL |
Appearance | White powder |
Isomeric SMILES | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)[C@@H](C(=O)O)N |
What is the chemical formula of glutathione?
The chemical formula of glutathione is C10H17N3O6S.
What are the three peptide compounds that make up glutathione?
The three peptide compounds that make up glutathione are glutamic acid, cysteine, and glycine.
What are the physical properties of glutathione?
Glutathione is a colorless transparent powder that is soluble in water and insoluble in ethanol and ether. It has a melting point of 192-195°C and an odorless smell.
What are some foods that are rich in glutathione?
Onions, garlic, tomato, fish, shrimp, lamb, and peppers are foods that are rich in glutathione.
What are some functions of reduced glutathione in the body?
Reduced glutathione plays a role in maintaining cell function, participating in metabolism, activating enzymes, and neutralizing free radicals.
How does glutathione act as an antidote?
Glutathione can bind to toxic compounds or carcinogens in the body and promote their excretion, serving as a detoxifying agent.
How does glutathione function as an antiallergic agent?
Glutathione can treat imbalances in acetylcholine and cholinesterase that cause allergies in the body.
How does glutathione protect the liver?
Glutathione inhibits the formation of fatty liver and can be used as a hepatoprotective agent to improve liver function in cases of liver dysfunction.
What is GSH depletion and how does it occur?
GSH depletion is the decrease in glutathione levels in the body due to a depletion of supplies, competition with other chemicals, or tissue damage.
What is the role of glutathione as an antioxidant in the body?
Glutathione acts as a natural activator for enzymes in the body, helping to remove free radicals, prevent cell damage, and improve the antioxidant ability of the skin.