Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0070 |
| Product Name | Glucosamine |
| CAS | 3416-24-8 |
| Structure |  |
| Synonyms | 2-Amino-2-deoxyglucose |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol |
| Molecular Weight | 179.17 g/mol |
| Molecular Formula | C6H13NO5 |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChI Key | MSWZFWKMSRAUBD-IVMDWMLBSA-N |
| Boiling Point | 311.69 °C |
| Melting Point | 88 °C |
| Purity | 0.98 |
| Density | 1.38 g/mL |
| Appearance | White to off-white solid |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O |
What is the chemical formula of Glucosamine?
The chemical formula of Glucosamine is C6H13NO5.
What is the molecular weight of Glucosamine?
The molecular weight of Glucosamine is 179.17.
What is the melting point of Glucosamine?
The melting point of Glucosamine is 88 °C.
In what form does Glucosamine exist in cell walls of crustaceans, insects, molds, and bacteria?
Glucosamine exists in the form of polymers or derivatives in the cell walls of organisms.
How is Glucosamine prepared?
Dehydrated glucose and ammonia react in absolute ethanol, and then it is hydrolyzed to produce crude Glucosamine.
What is the significance of Glucosamine hydrochloride as a natural substance?
Glucosamine hydrochloride stimulates the body to produce glycosaminoglycans to repair and form cartilage.
How does Glucosamine help in promoting articular cartilage repair?
Glucosamine stimulates the production of synovial fluid, strengthens the synthesis of connective tissue, and helps in absorbing water into cartilage.
What are the applications of Glucosamine?
Glucosamine is widely used in health medicine, health food, cosmetics, and other fields to improve human activities and promote the growth of synthetic life substances.
In what forms can Glucosamine be found naturally?
Glucosamine is found in mucopolysaccharides, chitin, and mucoproteins naturally.
How is Glucosamine sulfate used in the treatment of rheumatic disorders?
Glucosamine sulfate has been used in the treatment of rheumatic disorders, although it is not widely marketed for this purpose according to the World Health Organization.
If you have any questions, please contact us. You will get a satisfactory answer.
