Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0100 |
| Product Name | Galactose |
| CAS | 10257-28-0 |
| Structure |  |
| Synonyms | 2-Acetamido-6-O-(2-acetamido-2-deoxy-&beta |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Molecular Weight | 180.16 g/mol |
| Molecular Formula | C6H12O6 |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5-,6?/m1/s1 |
| InChI Key | WQZGKKKJIJFFOK-SVZMEOIVSA-N |
| Boiling Point | 410.8±45.0 °C |
| Melting Point | 168-170 °C |
| Density | 1.73 g/mL |
| Isomeric SMILES | C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
| pKa | 12.12±0.70 |
Galactose, a monosaccharide derived from either animal sources like lactose or plant-based sources such as galactoarabinan, serves as an essential component in the formation of glycolipids and glycoproteins. It plays a significant role in stimulating calcium absorption and enhancing the immune system, while also facilitating improved cellular communication. In the realm of cosmetics, galactose is utilized for its ability to aid in tissue repair and act as an anti-inflammatory agent. Moreover, it functions as a moisturizer, effectively increasing the skin's ability to retain water.
Is galactose a polyhydroxy acid (PHA)?
No, galactose is not a polyhydroxy acid (PHA). Despite having multiple hydroxyl (OH) groups, galactose lacks an acidic group. This structural characteristic distinguishes it from PHAs, which do include acidic components. Misclassification occurs occasionally due to the presence of multiple hydroxyl groups.
If you have any questions, please contact us. You will get a satisfactory answer.
