Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Etocrylene

Online Inquiry

Catalog Number	CI-GU-0156
Product Name	Etocrylene
CAS	5232-99-5
Structure
Synonyms	2-Propenoic acid, 2-cyano-3,3-diphenyl-, ethyl ester
IUPAC Name	ethyl 2-cyano-3,3-diphenylprop-2-enoate
Molecular Weight	277.3 g/mol
Molecular Formula	C18H15NO2
InChI	InChI=1S/C18H15NO2/c1-2-21-18(20)16(13-19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2H2,1H3
InChI Key	IAJNXBNRYMEYAZ-UHFFFAOYSA-N
Boiling Point	174 °C / 0.2mmHg
Melting Point	97-99 °C
Purity	95%
Density	1.05 g/mL
Appearance	Solid
Highest Usage In Residency Products	0.01
Isomeric SMILES	CCOC(=O)C(=C(C1=CC=CC=C1)C2=CC=CC=C2)C#N

Custom Q&A

What is the chemical formula for Ethyl 2-cyano-3,3-diphenylacrylate?

The chemical formula is C18H15NO2.

What is the boiling point of Ethyl 2-cyano-3,3-diphenylacrylate?

The boiling point is 174 °C at 0.2 mm Hg.

In what form does Ethyl 2-cyano-3,3-diphenylacrylate exist?

It exists in the form of a powder to crystal.

What is the melting point of Ethyl 2-cyano-3,3-diphenylacrylate?

The melting point is 97-99 °C.

What is the main function of Etocrylene?

Etocrylene functions as a UV absorber.

How is Etocrylene used in personal care products?

It can be used to protect cosmetics and personal care products from deterioration.

What is the synthesis method for Ethyl 2-cyano-3,3-diphenylacrylate?

It involves adding cyclohexane and benzophenone to a reaction kettle, among other steps.

What is the main application of Ethyl 2-cyano-3,3-diphenylacrylate?

It is used in making UV light absorbers in plastics, coatings, dyestuffs, vehicle glass, makeup, and sunscreen.

How does the structure of Ethyl 2-cyano-3,3-diphenylacrylate contribute to its ultraviolet absorption ability?

The two phenyl groups and carbonyl in its structure can form a larger π bond, giving it strong ultraviolet absorption ability.

Online Inquiry