Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Ethyl Butylacetylaminopropionate

Online Inquiry

Catalog Number	CI-SC-1231
Product Name	Ethyl Butylacetylaminopropionate
CAS	52304-36-6
Structure
Synonyms	Ethyl N-acetyl-N-butyl-beta-alaninate;beta-Alanine, N-acetyl-N-butyl-, ethyl ester
IUPAC Name	ethyl 3-[acetyl(butyl)amino]propanoate
Molecular Weight	215.29 g/mol
Molecular Formula	C11H21NO3
InChI	InChI=1S/C11H21NO3/c1-4-6-8-12(10(3)13)9-7-11(14)15-5-2/h4-9H2,1-3H3
InChI Key	VZRKEAFHFMSHCD-UHFFFAOYSA-N
Purity	95%
Density	0.99 g/mL
Appearance	Liquid
Isomeric SMILES	CCCCN(CCC(=O)OCC)C(=O)C

Custom Q&A

What is the chemical formula of Ethyl Butylacetylaminopropionate?

The chemical formula is C11H21NO3.

What is the molecular weight of Ethyl Butylacetylaminopropionate?

The molecular weight is 215.29 g/mol.

What are the synonyms of Ethyl Butylacetylaminopropionate?

N-ACETYL-N-BUTYL-BETA-ALANINE ETHYL ESTER, Candles-nontoxicrepellent, Insectrepellent, etc.

What is the melting point of Ethyl Butylacetylaminopropionate?

The melting point is below -20°.

What is the main use of Ethyl Butylacetylaminopropionate?

It is used as an insect repellent for application to human skin and clothing to repel biting arthropods.

What is the storage temperature recommended for Ethyl Butylacetylaminopropionate?

It should be sealed in dry, room temperature conditions.

What are the physical properties of Ethyl Butylacetylaminopropionate?

It is described as an oil with a colorless appearance.

What is the history of Ethyl Butylacetylaminopropionate?

It is a synthetic molecule derived from a natural amino acid, beta-alanine, developed in the early 1970s.

What is the EPA Substance Registry System reference for Ethyl Butylacetylaminopropionate?

N-Acetyl-N-butyl-.beta.-alanine ethyl ester (52304-36-6).

What is the main hazardous risk associated with Ethyl Butylacetylaminopropionate?

The risk statements include HS Code 29241990.

Online Inquiry