Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0085 |
| Product Name | Epigallocatechin Gallate |
| CAS | 989-51-5 |
| Structure |  |
| Synonyms | (-)-Epigallocatechin gallate;Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2R-cis)-;EGCG |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Molecular Weight | 458.37 g/mol |
| Molecular Formula | C22H18O11 |
| InChI | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
| InChI Key | WMBWREPUVVBILR-WIYYLYMNSA-N |
| Melting Point | 222-224 °C |
| Purity | 95% |
| Density | 1.9 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.005 |
| Highest Usage In Rinsing Products | 0.0125 |
| Isomeric SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| pKa | 7.75±0.25 |
If you have any questions, please contact us. You will get a satisfactory answer.
