Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1134 |
| Product Name | Elastin |
| CAS | 9007-58-3 |
| Synonyms | Elastins |
| IUPAC Name | (2S)-1-[(2S)-2-[[2-[[(2S,3S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-3-methylbutanoyl]-N-methylpyrrolidine-2-carboxamide |
| Molecular Weight | 552.7 g/mol |
| Molecular Formula | C27H48N6O6 |
| InChI | InChI=1S/C27H48N6O6/c1-9-17(6)23(32-24(36)19(13-15(2)3)30-18(7)34)26(38)29-14-21(35)31-22(16(4)5)27(39)33-12-10-11-20(33)25(37)28-8/h15-17,19-20,22-23H,9-14H2,1-8H3,(H,28,37)(H,29,38)(H,30,34)(H,31,35)(H,32,36)/t17-,19-,20-,22-,23-/m0/s1 |
| InChI Key | DPUYCSDGMSDKKV-MKBYFEBXSA-N |
| Purity | 90% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.3 |
| Isomeric SMILES | CC[C@H](C)[C@@H](C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC)NC(=O)[C@H](CC(C)C)NC(=O)C |
What is elastin and what role does it play in the body?
Elastin is an extracellular matrix protein crucial for providing elasticity and resilience to various tissues, including arteries, lungs, tendons, skin, and ligaments. It allows tissues to stretch and return to their original shape, facilitating dynamic facial expressions and movement.
How is elastin different from collagen?
While both elastin and collagen are structural proteins that help maintain skin texture and shape, elastin is significantly more flexible-up to 1000 times more than collagen. Elastin enables tissues to stretch and snap back, contributing primarily to elasticity, whereas collagen provides rigidity and support.
Where in the body is elastin most prevalent?
Elastin is predominantly found in the dermis layer of the skin, lungs, blood vessels, tendons, ligaments, and the bladder wall. While it is present in varying amounts, tissues like the skin contain higher levels of elastin to maintain suppleness.
How does elastin contribute to skin health?
Elastin plays a significant role in maintaining skin elasticity, which is critical for a young and healthy appearance. Strong elastin fibers help reduce wrinkles and sagging, promote wound and scar healing, smooth out skin tone and texture, and uphold the skin's structural integrity.
What happens to elastin as we age?
As we age, the production and quality of elastin in the skin can decline, leading to reduced elasticity and the formation of wrinkles and sagging. Maintaining healthy elastin levels is crucial for keeping the skin looking youthful and elastic.
Can the condition of elastin in the skin be improved?
Although the natural decrease in elastin with age cannot be completely halted, maintaining a healthy skin care regimen and lifestyle can support elastin function. Using products that protect and nourish the skin, along with a balanced diet and adequate hydration, may help prolong its elasticity and overall health.
What can damage elastin in the skin?
Factors such as UV exposure, pollution, smoking, and inflammation can damage elastin in the skin, leading to its breakdown and potentially causing skin damage or diseases. Protecting the skin from environmental stressors is key to maintaining healthy elastin levels.
If you have any questions, please contact us. You will get a satisfactory answer.
